[(2'R,4aS,6R,7S,9S,10S,10aS)-6,10-dihydroxy-1,1,2',4a-tetramethyl-5,8-dioxospiro[3,4,6,9,10,10a-hexahydro-2H-phenanthrene-7,1'-cyclopropane]-9-yl] formate
| Internal ID | 34928236-51aa-4058-9038-06c124c54af6 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | [(2'R,4aS,6R,7S,9S,10S,10aS)-6,10-dihydroxy-1,1,2',4a-tetramethyl-5,8-dioxospiro[3,4,6,9,10,10a-hexahydro-2H-phenanthrene-7,1'-cyclopropane]-9-yl] formate |
| SMILES (Canonical) | CC1CC12C(C(=O)C3=C(C2=O)C(C(C4C3(CCCC4(C)C)C)O)OC=O)O |
| SMILES (Isomeric) | C[C@@H]1C[C@@]12[C@H](C(=O)C3=C(C2=O)[C@@H]([C@H]([C@@H]4[C@@]3(CCCC4(C)C)C)O)OC=O)O |
| InChI | InChI=1S/C21H28O6/c1-10-8-21(10)17(25)11-12(13(23)18(21)26)20(4)7-5-6-19(2,3)16(20)14(24)15(11)27-9-22/h9-10,14-16,18,24,26H,5-8H2,1-4H3/t10-,14-,15+,16+,18+,20-,21-/m1/s1 |
| InChI Key | RCAKXKBFFJMSBP-IIRXGPNXSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.18858861 g/mol |
| Topological Polar Surface Area (TPSA) | 101.00 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
![2D Structure of [(2'R,4aS,6R,7S,9S,10S,10aS)-6,10-dihydroxy-1,1,2',4a-tetramethyl-5,8-dioxospiro[3,4,6,9,10,10a-hexahydro-2H-phenanthrene-7,1'-cyclopropane]-9-yl] formate](https://plantaedb.com/storage/docs/compounds/2023/11/033b2340-8475-11ee-82f7-e97d6b40c8a4.jpg "2D Structure of [(2'R,4aS,6R,7S,9S,10S,10aS)-6,10-dihydroxy-1,1,2',4a-tetramethyl-5,8-dioxospiro[3,4,6,9,10,10a-hexahydro-2H-phenanthrene-7,1'-cyclopropane]-9-yl] formate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.65% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.12% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.62% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.16% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.62% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.21% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.44% | 91.49% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.13% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.16% | 97.09% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.62% | 91.07% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.15% | 86.33% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.67% | 94.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.47% | 95.89% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.02% | 91.03% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.83% | 82.69% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.39% | 91.24% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 80.84% | 95.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Plectranthus lanuginosus |
| Plectranthus punctatus subsp. edulis |
| PubChem | 13894284 |
| LOTUS | LTS0085238 |
| wikiData | Q105233463 |