[4,5-Diacetyloxy-6-[2-[3',16-dihydroxy-7,9,13-trimethyl-5'-methylidene-4'-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-14-yl]oxy-5-hydroxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl]oxy-2-methyloxan-3-yl] acetate
Internal ID | ec522a8d-75d1-42c1-ab17-a199ceb6564e |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | [4,5-diacetyloxy-6-[2-[3',16-dihydroxy-7,9,13-trimethyl-5'-methylidene-4'-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-14-yl]oxy-5-hydroxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl]oxy-2-methyloxan-3-yl] acetate |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC=C5C4(C(CC(C5)O)OC6C(C(C(CO6)O)OC7C(C(C(CO7)O)O)O)OC8C(C(C(C(O8)C)OC(=O)C)OC(=O)C)OC(=O)C)C)C)OC19C(C(C(=C)CO9)OC1C(C(C(C(O1)CO)O)O)O)O |
SMILES (Isomeric) | CC1C2C(CC3C2(CCC4C3CC=C5C4(C(CC(C5)O)OC6C(C(C(CO6)O)OC7C(C(C(CO7)O)O)O)OC8C(C(C(C(O8)C)OC(=O)C)OC(=O)C)OC(=O)C)C)C)OC19C(C(C(=C)CO9)OC1C(C(C(C(O1)CO)O)O)O)O |
InChI | InChI=1S/C55H82O26/c1-20-17-71-55(48(68)42(20)78-50-41(67)39(65)38(64)34(16-56)76-50)21(2)36-33(81-55)15-30-28-10-9-26-13-27(60)14-35(54(26,8)29(28)11-12-53(30,36)7)77-51-46(44(32(62)19-70-51)79-49-40(66)37(63)31(61)18-69-49)80-52-47(75-25(6)59)45(74-24(5)58)43(22(3)72-52)73-23(4)57/h9,21-22,27-52,56,60-68H,1,10-19H2,2-8H3 |
InChI Key | YKUCPUKCKQHUMU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C55H82O26 |
Molecular Weight | 1159.20 g/mol |
Exact Mass | 1158.50943272 g/mol |
Topological Polar Surface Area (TPSA) | 374.00 Ų |
XlogP | -2.00 |
There are no found synonyms. |
![2D Structure of [4,5-Diacetyloxy-6-[2-[3',16-dihydroxy-7,9,13-trimethyl-5'-methylidene-4'-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-14-yl]oxy-5-hydroxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl]oxy-2-methyloxan-3-yl] acetate 2D Structure of [4,5-Diacetyloxy-6-[2-[3',16-dihydroxy-7,9,13-trimethyl-5'-methylidene-4'-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-14-yl]oxy-5-hydroxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl]oxy-2-methyloxan-3-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/02a057e0-856a-11ee-abb9-b7802eae3929.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.54% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.20% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 94.61% | 95.93% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 94.06% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.36% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.23% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.97% | 89.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 90.81% | 92.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.79% | 94.45% |
CHEMBL204 | P00734 | Thrombin | 90.35% | 96.01% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.43% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.90% | 97.25% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.74% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 85.51% | 98.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.79% | 91.19% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.79% | 96.00% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.20% | 91.24% |
CHEMBL5028 | O14672 | ADAM10 | 82.45% | 97.50% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.23% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.08% | 95.56% |
CHEMBL1871 | P10275 | Androgen Receptor | 80.62% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Broussonetia papyrifera |
PubChem | 162852192 |
LOTUS | LTS0272886 |
wikiData | Q105344167 |