[(1S,2R,5R,6R,7S)-2-[2-(furan-3-yl)ethyl]-2-hydroxy-7-methyl-3-methylidene-8-oxo-9-oxatricyclo[5.3.3.01,6]tridecan-5-yl] acetate
Internal ID | c8d78772-7e31-42a6-8cee-4e5352847745 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
IUPAC Name | [(1S,2R,5R,6R,7S)-2-[2-(furan-3-yl)ethyl]-2-hydroxy-7-methyl-3-methylidene-8-oxo-9-oxatricyclo[5.3.3.01,6]tridecan-5-yl] acetate |
SMILES (Canonical) | CC(=O)OC1CC(=C)C(C23C1C(CCC2)(C(=O)OC3)C)(CCC4=COC=C4)O |
SMILES (Isomeric) | CC(=O)O[C@@H]1CC(=C)[C@@]([C@]23[C@@H]1[C@](CCC2)(C(=O)OC3)C)(CCC4=COC=C4)O |
InChI | InChI=1S/C22H28O6/c1-14-11-17(28-15(2)23)18-20(3)7-4-8-21(18,13-27-19(20)24)22(14,25)9-5-16-6-10-26-12-16/h6,10,12,17-18,25H,1,4-5,7-9,11,13H2,2-3H3/t17-,18+,20+,21-,22-/m1/s1 |
InChI Key | UVJSXDGDMYHLIG-OCFWJZSCSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C22H28O6 |
Molecular Weight | 388.50 g/mol |
Exact Mass | 388.18858861 g/mol |
Topological Polar Surface Area (TPSA) | 86.00 Ų |
XlogP | 2.40 |
There are no found synonyms. |
![2D Structure of [(1S,2R,5R,6R,7S)-2-[2-(furan-3-yl)ethyl]-2-hydroxy-7-methyl-3-methylidene-8-oxo-9-oxatricyclo[5.3.3.01,6]tridecan-5-yl] acetate 2D Structure of [(1S,2R,5R,6R,7S)-2-[2-(furan-3-yl)ethyl]-2-hydroxy-7-methyl-3-methylidene-8-oxo-9-oxatricyclo[5.3.3.01,6]tridecan-5-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/01a613a0-84b1-11ee-805b-f3a59c5628f1.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.03% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.70% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.94% | 91.11% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.43% | 83.82% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.27% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.04% | 97.25% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.04% | 90.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.64% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.49% | 86.33% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 86.45% | 97.28% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.23% | 89.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 85.82% | 94.80% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.55% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.42% | 95.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.03% | 91.19% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 82.47% | 96.39% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.47% | 95.89% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.01% | 82.69% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 81.27% | 97.05% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.34% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Leonurus sibiricus |
PubChem | 11740991 |
LOTUS | LTS0082549 |
wikiData | Q105279918 |