(1R)-1alpha-(Formyloxy)-3beta-phenyl-3abeta-(1,3-benzodioxol-5-yl)-6,8-dimethoxy-8bbeta-hydroxy-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]benzofuran-2alpha-carboxylic acid methyl ester
Internal ID | c5a21563-8c23-48f6-b724-a39ef6248d73 |
Taxonomy | Organoheterocyclic compounds > Benzofurans > Flavaglines |
IUPAC Name | methyl (1R,2R,3S,3aR,8bS)-3a-(1,3-benzodioxol-5-yl)-1-formyloxy-8b-hydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate |
SMILES (Canonical) | COC1=CC2=C(C(=C1)OC)C3(C(C(C(C3(O2)C4=CC5=C(C=C4)OCO5)C6=CC=CC=C6)C(=O)OC)OC=O)O |
SMILES (Isomeric) | COC1=CC2=C(C(=C1)OC)[C@@]3([C@@H]([C@@H]([C@H]([C@@]3(O2)C4=CC5=C(C=C4)OCO5)C6=CC=CC=C6)C(=O)OC)OC=O)O |
InChI | InChI=1S/C29H26O10/c1-33-18-12-21(34-2)25-22(13-18)39-29(17-9-10-19-20(11-17)38-15-37-19)24(16-7-5-4-6-8-16)23(27(31)35-3)26(36-14-30)28(25,29)32/h4-14,23-24,26,32H,15H2,1-3H3/t23-,24-,26-,28+,29+/m1/s1 |
InChI Key | XKYRDXZNJADCQR-IDAMAFBJSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C29H26O10 |
Molecular Weight | 534.50 g/mol |
Exact Mass | 534.15259702 g/mol |
Topological Polar Surface Area (TPSA) | 119.00 Ų |
XlogP | 3.10 |
SCHEMBL16408451 |
(1R)-1alpha-(Formyloxy)-3beta-phenyl-3abeta-(1,3-benzodioxol-5-yl)-6,8-dimethoxy-8bbeta-hydroxy-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]benzofuran-2alpha-carboxylic acid methyl ester |
![2D Structure of (1R)-1alpha-(Formyloxy)-3beta-phenyl-3abeta-(1,3-benzodioxol-5-yl)-6,8-dimethoxy-8bbeta-hydroxy-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]benzofuran-2alpha-carboxylic acid methyl ester 2D Structure of (1R)-1alpha-(Formyloxy)-3beta-phenyl-3abeta-(1,3-benzodioxol-5-yl)-6,8-dimethoxy-8bbeta-hydroxy-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]benzofuran-2alpha-carboxylic acid methyl ester](https://plantaedb.com/storage/docs/compounds/2023/07/01940b60-223e-11ee-bcf8-7da5f06971d0.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL240 | Q12809 | HERG | 99.38% | 89.76% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.82% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.80% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.68% | 96.09% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 95.97% | 89.44% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.23% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.63% | 94.45% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 93.44% | 92.62% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.74% | 95.50% |
CHEMBL2535 | P11166 | Glucose transporter | 91.35% | 98.75% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 91.14% | 97.14% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.61% | 85.14% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.01% | 96.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 89.68% | 94.80% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 88.77% | 90.24% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.29% | 90.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.83% | 99.23% |
CHEMBL2581 | P07339 | Cathepsin D | 87.77% | 98.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.95% | 91.19% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.63% | 95.89% |
CHEMBL5028 | O14672 | ADAM10 | 83.92% | 97.50% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 83.51% | 85.49% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.29% | 96.77% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.72% | 91.07% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.53% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.36% | 97.09% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.85% | 89.67% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.48% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aglaia elliptica |
Aglaia perviridis |
Ammodendron karelinii |
Citrus japonica |
Duguetia chrysocarpa |
Phaseolus coccineus |
Pinus yunnanensis |
Sicyos edulis |
PubChem | 10721063 |
NPASS | NPC263955 |
ChEMBL | CHEMBL2331811 |
LOTUS | LTS0064941 |
wikiData | Q105329780 |