(4,5,16,16-Tetramethyl-10-oxo-12-propyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),8(13),11,17-pentaen-6-yl) acetate
Internal ID | 58dd8df1-6e94-475f-a3e7-3ba4536c99ed |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Pyranocoumarins > Angular pyranocoumarins |
IUPAC Name | (4,5,16,16-tetramethyl-10-oxo-12-propyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),8(13),11,17-pentaen-6-yl) acetate |
SMILES (Canonical) | CCCC1=CC(=O)OC2=C1C3=C(C=CC(O3)(C)C)C4=C2C(C(C(O4)C)C)OC(=O)C |
SMILES (Isomeric) | CCCC1=CC(=O)OC2=C1C3=C(C=CC(O3)(C)C)C4=C2C(C(C(O4)C)C)OC(=O)C |
InChI | InChI=1S/C24H28O6/c1-7-8-15-11-17(26)29-23-18(15)22-16(9-10-24(5,6)30-22)21-19(23)20(28-14(4)25)12(2)13(3)27-21/h9-13,20H,7-8H2,1-6H3 |
InChI Key | UVGXEFBQPYOCKP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H28O6 |
Molecular Weight | 412.50 g/mol |
Exact Mass | 412.18858861 g/mol |
Topological Polar Surface Area (TPSA) | 71.10 Ų |
XlogP | 4.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.76% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.53% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 94.53% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.39% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.91% | 86.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.08% | 97.25% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.42% | 96.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.10% | 89.00% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 86.48% | 95.71% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.34% | 91.19% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.95% | 99.17% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.84% | 92.62% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.38% | 94.73% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.92% | 96.77% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.25% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.68% | 99.23% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 80.33% | 98.59% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.05% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Calophyllum lanigerum |
PubChem | 1417 |
LOTUS | LTS0163300 |
wikiData | Q105279832 |