(1R,3R,4R,6S,9S)-4-hydroxy-9-(hydroxymethyl)-6-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7-oxatricyclo[4.3.0.03,9]nonan-8-one
| Internal ID | a53fab9f-4952-4f14-a851-cd42543c168f |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
| IUPAC Name | (1R,3R,4R,6S,9S)-4-hydroxy-9-(hydroxymethyl)-6-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7-oxatricyclo[4.3.0.03,9]nonan-8-one |
| SMILES (Canonical) | CC12CC(C3CC1(C3(C(=O)O2)CO)OC4C(C(C(C(O4)CO)O)O)O)O |
| SMILES (Isomeric) | C[C@]12C[C@H]([C@@H]3C[C@]1([C@@]3(C(=O)O2)CO)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O |
| InChI | InChI=1S/C16H24O10/c1-14-3-7(19)6-2-16(14,15(6,5-18)13(23)26-14)25-12-11(22)10(21)9(20)8(4-17)24-12/h6-12,17-22H,2-5H2,1H3/t6-,7+,8+,9+,10-,11+,12-,14-,15-,16-/m0/s1 |
| InChI Key | FXINXOAOBQPYDH-AKEPAMDRSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H24O10 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.13694696 g/mol |
| Topological Polar Surface Area (TPSA) | 166.00 Ų |
| XlogP | -2.70 |
| There are no found synonyms. |
![2D Structure of (1R,3R,4R,6S,9S)-4-hydroxy-9-(hydroxymethyl)-6-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7-oxatricyclo[4.3.0.03,9]nonan-8-one](https://plantaedb.com/storage/docs/compounds/2023/11/002af410-8786-11ee-9e0f-a50e2088dfc6.jpg "2D Structure of (1R,3R,4R,6S,9S)-4-hydroxy-9-(hydroxymethyl)-6-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7-oxatricyclo[4.3.0.03,9]nonan-8-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.62% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.91% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.57% | 97.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.74% | 85.14% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.81% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.09% | 95.56% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.79% | 95.83% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.42% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.65% | 100.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.58% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.82% | 98.95% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.56% | 94.75% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.52% | 86.92% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.33% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.20% | 89.00% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.13% | 91.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Baccharis sagittalis |
| Paeonia suffruticosa |
| Salvia melissodora |
| Salvia thymoides |
| PubChem | 102192168 |
| LOTUS | LTS0074506 |
| wikiData | Q105281917 |