(-)-Spectaline
Internal ID | 53f9eaa3-1b25-4579-97a7-9a3097d30e02 |
Taxonomy | Alkaloids and derivatives |
IUPAC Name | 14-[(2S,5R,6R)-5-hydroxy-6-methylpiperidin-2-yl]tetradecan-2-one |
SMILES (Canonical) | CC1C(CCC(N1)CCCCCCCCCCCCC(=O)C)O |
SMILES (Isomeric) | C[C@@H]1[C@@H](CC[C@@H](N1)CCCCCCCCCCCCC(=O)C)O |
InChI | InChI=1S/C20H39NO2/c1-17(22)13-11-9-7-5-3-4-6-8-10-12-14-19-15-16-20(23)18(2)21-19/h18-21,23H,3-16H2,1-2H3/t18-,19+,20-/m1/s1 |
InChI Key | SMOKZFNZPZHGMX-HSALFYBXSA-N |
Popularity | 5 references in papers |
Molecular Formula | C20H39NO2 |
Molecular Weight | 325.50 g/mol |
Exact Mass | 325.298079487 g/mol |
Topological Polar Surface Area (TPSA) | 49.30 Ų |
XlogP | 5.20 |
CHEMBL249464 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.71% | 96.09% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.57% | 83.82% |
CHEMBL2581 | P07339 | Cathepsin D | 94.29% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.52% | 91.11% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 90.63% | 95.92% |
CHEMBL220 | P22303 | Acetylcholinesterase | 90.15% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.00% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.75% | 97.09% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.31% | 95.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.32% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.64% | 97.25% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.56% | 100.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.00% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cassia leptophylla |
Senna spectabilis |
Senna spectabilis var. spectabilis |
PubChem | 10019240 |
LOTUS | LTS0199156 |
wikiData | Q105256055 |