(+)-Paulownin
Internal ID | 78e4bb4d-7b94-467c-8f33-f536ace246f4 |
Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans |
IUPAC Name | 3,6-bis(1,3-benzodioxol-5-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3a-ol |
SMILES (Canonical) | C1C2C(OCC2(C(O1)C3=CC4=C(C=C3)OCO4)O)C5=CC6=C(C=C5)OCO6 |
SMILES (Isomeric) | C1C2C(OCC2(C(O1)C3=CC4=C(C=C3)OCO4)O)C5=CC6=C(C=C5)OCO6 |
InChI | InChI=1S/C20H18O7/c21-20-8-23-18(11-1-3-14-16(5-11)26-9-24-14)13(20)7-22-19(20)12-2-4-15-17(6-12)27-10-25-15/h1-6,13,18-19,21H,7-10H2 |
InChI Key | CAQZFLPWHBKTTR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H18O7 |
Molecular Weight | 370.40 g/mol |
Exact Mass | 370.10525291 g/mol |
Topological Polar Surface Area (TPSA) | 75.60 Ų |
XlogP | 1.60 |
SCHEMBL10037549 |
BCP18483 |
B0005-189995 |
![2D Structure of (+)-Paulownin 2D Structure of (+)-Paulownin](https://plantaedb.com/storage/docs/compounds/2023/11/-paulownin-d83792033c94fd90026163596d4add42.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.73% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.77% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.19% | 94.45% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.01% | 96.77% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.65% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.02% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.78% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.19% | 100.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.14% | 92.62% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.91% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.63% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.09% | 85.14% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 82.94% | 89.63% |
CHEMBL2581 | P07339 | Cathepsin D | 81.93% | 98.95% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 80.27% | 80.96% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Amanoa oblongifolia |
Cleistanthus collinus |
Cleistanthus patulus |
Gmelina arborea |
Gmelina asiatica |
Markhamia lutea |
Markhamia stipulata |
Paulownia tomentosa |
Stereospermum acuminatissimum |
PubChem | 3321512 |
LOTUS | LTS0201024 |
wikiData | Q104951787 |