(+/-)-Nantenine
Internal ID | 2c7afa73-fe58-4831-b02f-f4e79969fabd |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | 18,19-dimethoxy-13-methyl-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(20),2,4(8),9,16,18-hexaene |
SMILES (Canonical) | CN1CCC2=CC(=C(C3=C2C1CC4=CC5=C(C=C43)OCO5)OC)OC |
SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C2C1CC4=CC5=C(C=C43)OCO5)OC)OC |
InChI | InChI=1S/C20H21NO4/c1-21-5-4-11-7-17(22-2)20(23-3)19-13-9-16-15(24-10-25-16)8-12(13)6-14(21)18(11)19/h7-9,14H,4-6,10H2,1-3H3 |
InChI Key | WSVWKHTVFGTTKJ-UHFFFAOYSA-N |
Popularity | 5 references in papers |
Molecular Formula | C20H21NO4 |
Molecular Weight | 339.40 g/mol |
Exact Mass | 339.14705815 g/mol |
Topological Polar Surface Area (TPSA) | 40.20 Ų |
XlogP | 3.20 |
Atomic LogP (AlogP) | 3.18 |
H-Bond Acceptor | 5 |
H-Bond Donor | 0 |
Rotatable Bonds | 2 |
42971-15-3 |
Thalictruberine |
CHEMBL467094 |
SCHEMBL1254591 |
DTXSID00962816 |
BDBM50114920 |
1,2-dimethoxy-9,10-methylenedioxyaporphine |
1,2-Dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H,10H-benzo[de][1,3]benzodioxolo[5,6-g]quinoline |
4H-Benzo(de)(1,3)benzodioxolo(5,6-g)quinoline, 5,6,6a,7-tetrahydro-1,2-dimethoxy-6-methyl- |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9459 | 94.59% |
Caco-2 | + | 0.9301 | 93.01% |
Blood Brain Barrier | + | 0.8750 | 87.50% |
Human oral bioavailability | - | 0.6571 | 65.71% |
Subcellular localzation | Lysosomes | 0.5163 | 51.63% |
OATP2B1 inhibitior | - | 0.8650 | 86.50% |
OATP1B1 inhibitior | + | 0.9388 | 93.88% |
OATP1B3 inhibitior | + | 0.9514 | 95.14% |
MATE1 inhibitior | - | 0.9000 | 90.00% |
OCT2 inhibitior | - | 0.5500 | 55.00% |
BSEP inhibitior | + | 0.7101 | 71.01% |
P-glycoprotein inhibitior | - | 0.6681 | 66.81% |
P-glycoprotein substrate | - | 0.8239 | 82.39% |
CYP3A4 substrate | + | 0.6211 | 62.11% |
CYP2C9 substrate | - | 0.6129 | 61.29% |
CYP2D6 substrate | + | 0.7342 | 73.42% |
CYP3A4 inhibition | + | 0.6228 | 62.28% |
CYP2C9 inhibition | - | 0.8237 | 82.37% |
CYP2C19 inhibition | + | 0.7057 | 70.57% |
CYP2D6 inhibition | + | 0.7688 | 76.88% |
CYP1A2 inhibition | - | 0.7119 | 71.19% |
CYP2C8 inhibition | - | 0.7774 | 77.74% |
CYP inhibitory promiscuity | - | 0.5422 | 54.22% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9800 | 98.00% |
Carcinogenicity (trinary) | Non-required | 0.5880 | 58.80% |
Eye corrosion | - | 0.9903 | 99.03% |
Eye irritation | - | 0.9827 | 98.27% |
Skin irritation | - | 0.8002 | 80.02% |
Skin corrosion | - | 0.9489 | 94.89% |
Ames mutagenesis | + | 0.8700 | 87.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.8283 | 82.83% |
Micronuclear | - | 0.5200 | 52.00% |
Hepatotoxicity | - | 0.7449 | 74.49% |
skin sensitisation | - | 0.8694 | 86.94% |
Respiratory toxicity | + | 0.7667 | 76.67% |
Reproductive toxicity | + | 0.8778 | 87.78% |
Mitochondrial toxicity | + | 0.8250 | 82.50% |
Nephrotoxicity | - | 0.7278 | 72.78% |
Acute Oral Toxicity (c) | III | 0.7399 | 73.99% |
Estrogen receptor binding | + | 0.6017 | 60.17% |
Androgen receptor binding | - | 0.5821 | 58.21% |
Thyroid receptor binding | + | 0.6046 | 60.46% |
Glucocorticoid receptor binding | + | 0.7962 | 79.62% |
Aromatase binding | - | 0.5112 | 51.12% |
PPAR gamma | + | 0.7106 | 71.06% |
Honey bee toxicity | - | 0.8223 | 82.23% |
Biodegradation | - | 0.9500 | 95.00% |
Crustacea aquatic toxicity | + | 0.6900 | 69.00% |
Fish aquatic toxicity | + | 0.9362 | 93.62% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL229 | P35348 | Alpha-1a adrenergic receptor |
2 nM 430 nM |
Ki Ki |
via Super-PRED
via Super-PRED |
CHEMBL223 | P25100 | Alpha-1d adrenergic receptor |
340 nM |
Ki |
via Super-PRED
|
CHEMBL1942 | P18089 | Alpha-2b adrenergic receptor |
252 nM |
Ki |
via Super-PRED
|
CHEMBL1916 | P18825 | Alpha-2c adrenergic receptor |
181 nM |
Ki |
via Super-PRED
|
CHEMBL2056 | P21728 | Dopamine D1 receptor |
895 nM |
Ki |
via Super-PRED
|
CHEMBL217 | P14416 | Dopamine D2 receptor |
858 nM |
Ki |
via Super-PRED
|
CHEMBL234 | P35462 | Dopamine D3 receptor |
309 nM |
Ki |
via Super-PRED
|
CHEMBL219 | P21917 | Dopamine D4 receptor |
262 nM |
Ki |
via Super-PRED
|
CHEMBL1941 | P25021 | Histamine H2 receptor |
672 nM |
Ki |
via Super-PRED
|
CHEMBL1898 | P28222 | Serotonin 1b (5-HT1b) receptor |
100 nM |
Ki |
via Super-PRED
|
CHEMBL1983 | P28221 | Serotonin 1d (5-HT1d) receptor |
49 nM |
Ki |
via Super-PRED
|
CHEMBL224 | P28223 | Serotonin 2a (5-HT2a) receptor |
832 nM |
Ki |
via Super-PRED
|
CHEMBL1833 | P41595 | Serotonin 2b (5-HT2b) receptor |
543 nM |
Ki |
via Super-PRED
|
CHEMBL3371 | P50406 | Serotonin 6 (5-HT6) receptor |
257 nM |
Ki |
via Super-PRED
|
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor |
67 nM |
Ki |
via Super-PRED
|
CHEMBL228 | P31645 | Serotonin transporter |
244 nM |
Ki |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 99.02% | 96.77% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.22% | 96.09% |
CHEMBL5747 | Q92793 | CREB-binding protein | 93.75% | 95.12% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 92.84% | 96.76% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 92.43% | 96.86% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 92.42% | 93.40% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.34% | 95.56% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 90.16% | 82.38% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 89.98% | 82.67% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 89.08% | 88.48% |
CHEMBL2581 | P07339 | Cathepsin D | 88.66% | 98.95% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.60% | 92.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.03% | 86.33% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 86.73% | 95.78% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.36% | 89.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.63% | 90.00% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 85.30% | 90.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.29% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.01% | 89.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.99% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.40% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.08% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.00% | 99.17% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.86% | 89.50% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 81.52% | 92.38% |
CHEMBL2535 | P11166 | Glucose transporter | 81.50% | 98.75% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.48% | 97.14% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.45% | 93.99% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.22% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cassytha pubescens |
Dehaasia incrassata |
Nandina domestica |
Ocotea macrophylla |
PubChem | 181743 |
LOTUS | LTS0119545 |
wikiData | Q82944584 |