(-)-Lirinidine
Internal ID | 38a0707c-afa2-4354-88e0-1ed04c12ca21 |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | (6aR)-2-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol |
SMILES (Canonical) | CN1CCC2=CC(=C(C3=C2C1CC4=CC=CC=C43)O)OC |
SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C2[C@H]1CC4=CC=CC=C43)O)OC |
InChI | InChI=1S/C18H19NO2/c1-19-8-7-12-10-15(21-2)18(20)17-13-6-4-3-5-11(13)9-14(19)16(12)17/h3-6,10,14,20H,7-9H2,1-2H3/t14-/m1/s1 |
InChI Key | YXVXMURDCBMPRH-CQSZACIVSA-N |
Popularity | 6 references in papers |
Molecular Formula | C18H19NO2 |
Molecular Weight | 281.30 g/mol |
Exact Mass | 281.141578849 g/mol |
Topological Polar Surface Area (TPSA) | 32.70 Ų |
XlogP | 2.60 |
(?)-Lirinidine |
SCHEMBL4159150 |
CHEMBL2316500 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.99% | 96.09% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 97.09% | 91.00% |
CHEMBL2581 | P07339 | Cathepsin D | 96.75% | 98.95% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 96.75% | 95.62% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.76% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.39% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.84% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.26% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 88.62% | 98.75% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 87.43% | 91.79% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.38% | 95.89% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.31% | 89.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.10% | 90.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.32% | 85.14% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.18% | 93.40% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.58% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Annona purpurea |
Annona squamosa |
Artabotrys venustus |
Magnolia obovata |
Magnolia officinalis |
Nelumbo nucifera |
Papaver orientale |
PubChem | 821343 |
NPASS | NPC166014 |
ChEMBL | CHEMBL2316500 |
LOTUS | LTS0271067 |
wikiData | Q105368232 |