(-)-Chestnutamide
| Internal ID | 80694be2-e291-4acf-82b8-37469d7cea9e |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives |
| IUPAC Name | 9,11-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3,5,7-tetraene-2,12-dione |
| SMILES (Canonical) | C1CC(=O)N2C1CC3=C2NC4=CC=CC=C4C3=O |
| SMILES (Isomeric) | C1CC(=O)N2C1CC3=C2NC4=CC=CC=C4C3=O |
| InChI | InChI=1S/C14H12N2O2/c17-12-6-5-8-7-10-13(18)9-3-1-2-4-11(9)15-14(10)16(8)12/h1-4,8H,5-7H2,(H,15,18) |
| InChI Key | RGLGKZJBPLWSML-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.089877630 g/mol |
| Topological Polar Surface Area (TPSA) | 49.40 Ų |
| XlogP | 1.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 97.47% | 93.99% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.81% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.71% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.88% | 98.95% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 94.52% | 94.23% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 93.21% | 88.56% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.07% | 83.82% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 89.86% | 93.40% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 89.21% | 92.98% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.33% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.93% | 99.23% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 87.79% | 92.67% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 87.49% | 90.71% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 87.40% | 90.08% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.91% | 94.45% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 86.50% | 95.62% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 86.27% | 96.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.77% | 98.75% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 85.71% | 91.49% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.43% | 94.62% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.13% | 96.09% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 83.08% | 98.59% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.34% | 89.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.73% | 94.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.58% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Castanea mollissima |
| PubChem | 163184283 |
| LOTUS | LTS0194212 |
| wikiData | Q105235933 |