(+)-Catechin-6-c-beta-d-glucopyranoside
Internal ID | b719f032-a13d-4ef4-817f-08a8c023b528 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid C-glycosides |
IUPAC Name | (2R,3S)-2-(3,4-dihydroxyphenyl)-6-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
SMILES (Canonical) | C1C(C(OC2=C1C(=C(C(=C2)O)C3C(C(C(C(O3)CO)O)O)O)O)C4=CC(=C(C=C4)O)O)O |
SMILES (Isomeric) | C1[C@@H]([C@H](OC2=C1C(=C(C(=C2)O)[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)C4=CC(=C(C=C4)O)O)O |
InChI | InChI=1S/C21H24O11/c22-6-14-17(28)18(29)19(30)21(32-14)15-11(25)5-13-8(16(15)27)4-12(26)20(31-13)7-1-2-9(23)10(24)3-7/h1-3,5,12,14,17-30H,4,6H2/t12-,14+,17+,18-,19+,20+,21-/m0/s1 |
InChI Key | PWMSPKVTJLJDDS-CPKJHJHWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H24O11 |
Molecular Weight | 452.40 g/mol |
Exact Mass | 452.13186158 g/mol |
Topological Polar Surface Area (TPSA) | 201.00 Ų |
XlogP | -1.00 |
(+)-catechin-6-c-beta-d-glucopyranoside |
105371-27-5 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.79% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.36% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.03% | 91.49% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.15% | 97.09% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.53% | 83.82% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.92% | 94.73% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 87.74% | 96.37% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.62% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 86.86% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.67% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.45% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.79% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.01% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dryopteris crassirhizoma |
PubChem | 21626712 |
LOTUS | LTS0118388 |
wikiData | Q105215902 |