Zrxauosecwydma-dtwkunhwsa-
| Internal ID | f156a9a2-576b-497d-82bd-1d130a951d2f |
| Taxonomy | Organoheterocyclic compounds > Piperidines |
| IUPAC Name | (2R)-1-[(2S)-piperidin-2-yl]butan-2-ol |
| SMILES (Canonical) | CCC(CC1CCCCN1)O |
| SMILES (Isomeric) | CC[C@H](C[C@@H]1CCCCN1)O |
| InChI | InChI=1S/C9H19NO/c1-2-9(11)7-8-5-3-4-6-10-8/h8-11H,2-7H2,1H3/t8-,9+/m0/s1 |
| InChI Key | ZRXAUOSECWYDMA-DTWKUNHWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.25 g/mol |
| Exact Mass | 157.146664230 g/mol |
| Topological Polar Surface Area (TPSA) | 32.30 Ų |
| XlogP | 1.30 |
| InChI=1/C9H19NO/c1-2-9(11)7-8-5-3-4-6-10-8/h8-11H,2-7H2,1H3/t8-,9+/m0/s1 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.51% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.69% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.09% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.75% | 98.95% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 87.56% | 95.56% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.54% | 96.95% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 86.04% | 92.88% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 84.66% | 98.10% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.87% | 98.75% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.65% | 93.03% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.19% | 94.45% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 82.84% | 97.64% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.05% | 92.62% |
| CHEMBL268 | P43235 | Cathepsin K | 81.58% | 96.85% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.75% | 97.50% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.31% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Andrachne aspera |
| PubChem | 21599719 |
| LOTUS | LTS0055841 |
| wikiData | Q105382301 |