Zlpmihavswbsmf-djfzvpldsa-
Internal ID | f4af6f72-b902-4cbe-8561-e073b418be7d |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | [(3S,4aS)-5-acetyloxy-6,8,10-trihydroxy-7-(2-hydroxypropyl)-1,1,4a-trimethyl-9-oxo-3,4-dihydro-2H-phenanthren-3-yl] acetate |
SMILES (Canonical) | CC(CC1=C(C2=C(C(=C1O)OC(=O)C)C3(CC(CC(C3=C(C2=O)O)(C)C)OC(=O)C)C)O)O |
SMILES (Isomeric) | CC(CC1=C(C2=C(C(=C1O)OC(=O)C)[C@]3(C[C@H](CC(C3=C(C2=O)O)(C)C)OC(=O)C)C)O)O |
InChI | InChI=1S/C24H30O9/c1-10(25)7-14-17(28)15-16(21(18(14)29)33-12(3)27)24(6)9-13(32-11(2)26)8-23(4,5)22(24)20(31)19(15)30/h10,13,25,28-29,31H,7-9H2,1-6H3/t10?,13-,24+/m0/s1 |
InChI Key | ZLPMIHAVSWBSMF-DJFZVPLDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H30O9 |
Molecular Weight | 462.50 g/mol |
Exact Mass | 462.18898253 g/mol |
Topological Polar Surface Area (TPSA) | 151.00 Ų |
XlogP | 3.20 |
InChI=1/C24H30O9/c1-10(25)7-14-17(28)15-16(21(18(14)29)33-12(3)27)24(6)9-13(32-11(2)26)8-23(4,5)22(24)20(31)19(15)30/h10,13,25,28-29,31H,7-9H2,1-6H3/t10?,13-,24+/m0/s1 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.32% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 97.78% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.65% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.64% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.22% | 85.14% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.81% | 96.38% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.64% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.31% | 91.19% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.57% | 95.56% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 87.20% | 92.68% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.18% | 94.75% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 86.35% | 98.75% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.02% | 99.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.92% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.97% | 97.25% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.29% | 90.08% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.05% | 96.47% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.63% | 82.69% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.94% | 99.15% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.21% | 94.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.71% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Plectranthus xanthanthus |
PubChem | 10863519 |
LOTUS | LTS0085973 |
wikiData | Q105379041 |