Zizhine K
| Internal ID | 1946611a-46c4-49d9-8fb8-cfee42f2e8e1 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (2Z,5Z,9E)-2-[2-(2,5-dihydroxyphenyl)-2-oxoethylidene]-6-(hydroxymethyl)-11-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-10-methylundeca-5,9-dienoic acid |
| SMILES (Canonical) | CC(=CCCC(=CCCC(=CC(=O)C1=C(C=CC(=C1)O)O)C(=O)O)CO)COC(=O)C=CC2=CC=C(C=C2)O |
| SMILES (Isomeric) | C/C(=C\CC/C(=C/CC/C(=C/C(=O)C1=C(C=CC(=C1)O)O)/C(=O)O)/CO)/COC(=O)/C=C/C2=CC=C(C=C2)O |
| InChI | InChI=1S/C30H32O9/c1-20(19-39-29(36)15-10-21-8-11-24(32)12-9-21)4-2-5-22(18-31)6-3-7-23(30(37)38)16-28(35)26-17-25(33)13-14-27(26)34/h4,6,8-17,31-34H,2-3,5,7,18-19H2,1H3,(H,37,38)/b15-10+,20-4+,22-6-,23-16- |
| InChI Key | UGBXWZTUBVGEGR-XVZWSDEUSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H32O9 |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.20463259 g/mol |
| Topological Polar Surface Area (TPSA) | 162.00 Ų |
| XlogP | 5.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.45% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.24% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.25% | 99.17% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.72% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.20% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.32% | 96.09% |
| CHEMBL3194 | P02766 | Transthyretin | 91.74% | 90.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.02% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.11% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.77% | 96.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.59% | 94.73% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.07% | 99.15% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.73% | 94.62% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.35% | 95.50% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 82.29% | 92.51% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.59% | 90.00% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.86% | 91.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.85% | 89.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.44% | 93.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146683377 |
| LOTUS | LTS0215827 |
| wikiData | Q105272252 |