(Z)-N-methoxy-2-[4-(3-methylbut-2-enoxy)phenyl]ethanimine
| Internal ID | 257c1934-de40-461b-9c2f-441df33813ec |
| Taxonomy | Benzenoids > Phenol ethers |
| IUPAC Name | (Z)-N-methoxy-2-[4-(3-methylbut-2-enoxy)phenyl]ethanimine |
| SMILES (Canonical) | CC(=CCOC1=CC=C(C=C1)CC=NOC)C |
| SMILES (Isomeric) | CC(=CCOC1=CC=C(C=C1)C/C=N\OC)C |
| InChI | InChI=1S/C14H19NO2/c1-12(2)9-11-17-14-6-4-13(5-7-14)8-10-15-16-3/h4-7,9-10H,8,11H2,1-3H3/b15-10- |
| InChI Key | CCXXKTIUTYWLRV-GDNBJRDFSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.141578849 g/mol |
| Topological Polar Surface Area (TPSA) | 30.80 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
![2D Structure of (Z)-N-methoxy-2-[4-(3-methylbut-2-enoxy)phenyl]ethanimine](https://plantaedb.com/storage/docs/compounds/2023/11/z-n-methoxy-2-4-3-methylbut-2-enoxyphenylethanimine.jpg "2D Structure of (Z)-N-methoxy-2-[4-(3-methylbut-2-enoxy)phenyl]ethanimine")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.15% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.90% | 99.17% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 91.74% | 97.53% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.27% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.25% | 96.09% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 89.17% | 90.24% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.23% | 90.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.65% | 95.89% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.59% | 94.73% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.44% | 96.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.62% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.56% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.38% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.14% | 86.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.74% | 97.09% |
| CHEMBL240 | Q12809 | HERG | 80.40% | 89.76% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Atalantia ceylanica |
| PubChem | 10847262 |
| LOTUS | LTS0079070 |
| wikiData | Q104953945 |