(Z)-N-[2-(4-hydroxyphenyl)ethyl]-3-methyldodec-2-enamide
| Internal ID | 819aea9b-53fb-4895-be85-8bff4ebf2ed7 |
| Taxonomy | Benzenoids > Phenols > 1-hydroxy-2-unsubstituted benzenoids |
| IUPAC Name | (Z)-N-[2-(4-hydroxyphenyl)ethyl]-3-methyldodec-2-enamide |
| SMILES (Canonical) | CCCCCCCCCC(=CC(=O)NCCC1=CC=C(C=C1)O)C |
| SMILES (Isomeric) | CCCCCCCCC/C(=C\C(=O)NCCC1=CC=C(C=C1)O)/C |
| InChI | InChI=1S/C21H33NO2/c1-3-4-5-6-7-8-9-10-18(2)17-21(24)22-16-15-19-11-13-20(23)14-12-19/h11-14,17,23H,3-10,15-16H2,1-2H3,(H,22,24)/b18-17- |
| InChI Key | NBUAIVBXANEDGZ-ZCXUNETKSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C21H33NO2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.251129295 g/mol |
| Topological Polar Surface Area (TPSA) | 49.30 Ų |
| XlogP | 6.80 |
| (Z)-N-[2-(4-hydroxyphenyl)ethyl]-3-methyldodec-2-enamide |
![2D Structure of (Z)-N-[2-(4-hydroxyphenyl)ethyl]-3-methyldodec-2-enamide](https://plantaedb.com/storage/docs/compounds/2023/11/z-n-2-4-hydroxyphenylethyl-3-methyldodec-2-enamide.jpg "2D Structure of (Z)-N-[2-(4-hydroxyphenyl)ethyl]-3-methyldodec-2-enamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.09% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.65% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.93% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.41% | 96.09% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 94.43% | 92.08% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.68% | 94.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.18% | 94.73% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.12% | 97.29% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.10% | 100.00% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 84.85% | 94.00% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 83.89% | 89.33% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 83.34% | 96.67% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.25% | 96.95% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.01% | 97.21% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 82.34% | 92.29% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.26% | 90.71% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.74% | 100.00% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.26% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 21773786 |
| LOTUS | LTS0210113 |
| wikiData | Q105176990 |