(Z)-4''-Methoxyglobularimin
Internal ID | 3cb34ad9-5e9f-4fd1-b779-3768b6cca7f0 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | [(1S,4aR,5S,6R,7S,7aS)-5,6,7-trihydroxy-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-7-yl]methyl (Z)-3-(4-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | COC1=CC=C(C=C1)C=CC(=O)OCC2(C3C(C=COC3OC4C(C(C(C(O4)CO)O)O)O)C(C2O)O)O |
SMILES (Isomeric) | COC1=CC=C(C=C1)/C=C\C(=O)OC[C@]2([C@@H]3[C@@H](C=CO[C@H]3O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)[C@@H]([C@H]2O)O)O |
InChI | InChI=1S/C25H32O13/c1-34-13-5-2-12(3-6-13)4-7-16(27)36-11-25(33)17-14(18(28)22(25)32)8-9-35-23(17)38-24-21(31)20(30)19(29)15(10-26)37-24/h2-9,14-15,17-24,26,28-33H,10-11H2,1H3/b7-4-/t14-,15-,17-,18+,19-,20+,21-,22-,23+,24+,25-/m1/s1 |
InChI Key | UHDGRSJULUZYEF-STXKCDATSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H32O13 |
Molecular Weight | 540.50 g/mol |
Exact Mass | 540.18429107 g/mol |
Topological Polar Surface Area (TPSA) | 205.00 Ų |
XlogP | -1.60 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.35% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.70% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 97.17% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.50% | 86.33% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.91% | 90.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.11% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.82% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.58% | 90.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.02% | 86.92% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.81% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.88% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.34% | 94.73% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.29% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Achillea millefolium |
Premna odorata |
PubChem | 100913916 |
NPASS | NPC11546 |
LOTUS | LTS0044538 |
wikiData | Q105272718 |