(Z)-2-[(2R,12bS)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]but-2-en-1-ol
| Internal ID | 67a39d8b-5619-4cbb-803d-56e2adeae4ff |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyridoindoles > Beta carbolines |
| IUPAC Name | (Z)-2-[(2R,12bS)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]but-2-en-1-ol |
| SMILES (Canonical) | CC=C(CO)C1CCN2CCC3=C(C2C1)NC4=CC=CC=C34 |
| SMILES (Isomeric) | C/C=C(\CO)/[C@@H]1CCN2CCC3=C([C@@H]2C1)NC4=CC=CC=C34 |
| InChI | InChI=1S/C19H24N2O/c1-2-13(12-22)14-7-9-21-10-8-16-15-5-3-4-6-17(15)20-19(16)18(21)11-14/h2-6,14,18,20,22H,7-12H2,1H3/b13-2+/t14-,18+/m1/s1 |
| InChI Key | OLINLOVNBVHJHR-OOLNHQKQSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.188863393 g/mol |
| Topological Polar Surface Area (TPSA) | 39.30 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
![2D Structure of (Z)-2-[(2R,12bS)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]but-2-en-1-ol](https://plantaedb.com/storage/docs/compounds/2023/11/z-2-2r12bs-1234671212b-octahydroindolo23-aquinolizin-2-ylbut-2-en-1-ol.jpg "2D Structure of (Z)-2-[(2R,12bS)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]but-2-en-1-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.17% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.75% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.75% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.72% | 95.56% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 92.60% | 88.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.12% | 97.09% |
| CHEMBL240 | Q12809 | HERG | 89.17% | 89.76% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 87.19% | 91.71% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.52% | 97.25% |
| CHEMBL228 | P31645 | Serotonin transporter | 85.14% | 95.51% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 84.05% | 90.71% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.62% | 100.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.13% | 90.08% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.55% | 93.99% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.77% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Strychnos johnsonii |
| PubChem | 13892230 |
| LOTUS | LTS0176270 |
| wikiData | Q105193989 |