(Z)-14-methylpentadec-3-enenitrile
| Internal ID | 33a9ef80-299a-46ec-9562-020cbc5e318d |
| Taxonomy | Organic nitrogen compounds > Organonitrogen compounds > Organic cyanides > Nitriles |
| IUPAC Name | (Z)-14-methylpentadec-3-enenitrile |
| SMILES (Canonical) | CC(C)CCCCCCCCCC=CCC#N |
| SMILES (Isomeric) | CC(C)CCCCCCCCC/C=C\CC#N |
| InChI | InChI=1S/C16H29N/c1-16(2)14-12-10-8-6-4-3-5-7-9-11-13-15-17/h9,11,16H,3-8,10,12-14H2,1-2H3/b11-9- |
| InChI Key | NYXFTJGURNRCKM-LUAWRHEFSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.229999929 g/mol |
| Topological Polar Surface Area (TPSA) | 23.80 Ų |
| XlogP | 6.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2039 | P27338 | Monoamine oxidase B | 94.81% | 92.51% |
| CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 93.19% | 92.95% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 93.19% | 95.58% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.90% | 98.95% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 90.85% | 93.31% |
| CHEMBL3837 | P07711 | Cathepsin L | 90.83% | 96.61% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.04% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.87% | 96.09% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 88.51% | 89.63% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.38% | 96.47% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.56% | 96.00% |
| CHEMBL239 | Q07869 | Peroxisome proliferator-activated receptor alpha | 85.38% | 90.75% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 84.41% | 87.45% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.22% | 93.99% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.11% | 93.56% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.02% | 94.80% |
| CHEMBL1871 | P10275 | Androgen Receptor | 81.21% | 96.43% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 80.27% | 96.25% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 80.01% | 89.34% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139591513 |
| LOTUS | LTS0217415 |
| wikiData | Q105187757 |