(Z)-12-methyltetradec-3-enenitrile
| Internal ID | 231110ba-ff39-4a39-b1d7-b1cf48dbe512 |
| Taxonomy | Organic nitrogen compounds > Organonitrogen compounds > Organic cyanides > Nitriles |
| IUPAC Name | (Z)-12-methyltetradec-3-enenitrile |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H27N/c1-3-15(2)13-11-9-7-5-4-6-8-10-12-14-16/h8,10,15H,3-7,9,11-13H2,1-2H3/b10-8- |
| InChI Key | MCWXJMCJFPSWBN-NTMALXAHSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.38 g/mol |
| Exact Mass | 221.214349865 g/mol |
| Topological Polar Surface Area (TPSA) | 23.80 Ų |
| XlogP | 6.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 94.26% | 95.58% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.01% | 98.95% |
| CHEMBL239 | Q07869 | Peroxisome proliferator-activated receptor alpha | 92.34% | 90.75% |
| CHEMBL3837 | P07711 | Cathepsin L | 91.03% | 96.61% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.49% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.04% | 96.09% |
| CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 88.77% | 92.95% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 88.50% | 89.34% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.85% | 96.47% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.78% | 96.00% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.04% | 92.86% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 84.97% | 87.45% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 84.36% | 93.31% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.93% | 93.99% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 83.85% | 92.51% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 83.36% | 89.63% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.95% | 93.56% |
| CHEMBL202 | P00374 | Dihydrofolate reductase | 82.79% | 89.92% |
| CHEMBL1871 | P10275 | Androgen Receptor | 82.70% | 96.43% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.25% | 90.17% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 81.86% | 97.00% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 80.30% | 96.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139591509 |
| LOTUS | LTS0077329 |
| wikiData | Q105161508 |