Yuexiandajisu E
Internal ID | 57a664aa-f6cf-40a2-b00e-961a282486a8 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
IUPAC Name | (4aR,6aR,7R,10aS,11R,11aR,11bR)-6a,7,11-trihydroxy-4,4,8,11b-tetramethyl-1,2,3,4a,5,6,7,10a,11,11a-decahydronaphtho[2,1-f][1]benzofuran-9-one |
SMILES (Canonical) | CC1=C2C(C(C3C4(CCCC(C4CCC3(C2O)O)(C)C)C)O)OC1=O |
SMILES (Isomeric) | CC1=C2[C@@H]([C@@H]([C@H]3[C@@]4(CCCC([C@H]4CC[C@@]3([C@@H]2O)O)(C)C)C)O)OC1=O |
InChI | InChI=1S/C20H30O5/c1-10-12-14(25-17(10)23)13(21)15-19(4)8-5-7-18(2,3)11(19)6-9-20(15,24)16(12)22/h11,13-16,21-22,24H,5-9H2,1-4H3/t11-,13+,14+,15+,16-,19-,20-/m1/s1 |
InChI Key | BEVHDQRDCPDJKW-YRJLCNQLSA-N |
Popularity | 4 references in papers |
Molecular Formula | C20H30O5 |
Molecular Weight | 350.40 g/mol |
Exact Mass | 350.20932405 g/mol |
Topological Polar Surface Area (TPSA) | 87.00 Ų |
XlogP | 1.90 |
866556-16-3 |
(4Ar,6aR,7R,10aS,11R,11aR,11bR)-6a,7,11-trihydroxy-4,4,8,11b-tetramethyl-1,2,3,4a,5,6,7,10a,11,11a-decahydronaphtho[2,1-f][1]benzofuran-9-one |
CHEMBL3746044 |
HY-N10839 |
FS-8047 |
CS-0637045 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.49% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.87% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.64% | 91.11% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 90.51% | 96.38% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.39% | 94.75% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.97% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.64% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.51% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.43% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 84.61% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.53% | 95.89% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.21% | 93.03% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.99% | 97.14% |
CHEMBL204 | P00734 | Thrombin | 81.54% | 96.01% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.25% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Euphorbia ebracteolata |
PubChem | 102004594 |
LOTUS | LTS0103008 |
wikiData | Q104933608 |