Yfwgivsxyiaunl-ptukzhmtsa-
| Internal ID | 9e9b1d56-60d1-408f-8b7c-8d4ac098e456 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | [(1R,3R,4R,5R,7S,8R,9R,10Z,12S,13S,14S)-4,13-diacetyloxy-9-hydroxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] benzoate |
| SMILES (Canonical) | CC1CC23C(=O)C(C(C4C(C4(C)C)C(C(C(=CC2(C1OC(=O)C)O3)C)O)OC(=O)C5=CC=CC=C5)OC(=O)C)C |
| SMILES (Isomeric) | C[C@H]1C[C@]23C(=O)[C@@H]([C@@H]([C@@H]4[C@@H](C4(C)C)[C@H]([C@@H](/C(=C\[C@@]2([C@H]1OC(=O)C)O3)/C)O)OC(=O)C5=CC=CC=C5)OC(=O)C)C |
| InChI | InChI=1S/C31H38O9/c1-15-13-31-27(38-19(5)33)16(2)14-30(31,40-31)26(35)17(3)24(37-18(4)32)21-22(29(21,6)7)25(23(15)34)39-28(36)20-11-9-8-10-12-20/h8-13,16-17,21-25,27,34H,14H2,1-7H3/b15-13-/t16-,17+,21-,22+,23+,24-,25+,27-,30-,31-/m0/s1 |
| InChI Key | YFWGIVSXYIAUNL-PTUKZHMTSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C31H38O9 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.25158279 g/mol |
| Topological Polar Surface Area (TPSA) | 129.00 Ų |
| XlogP | 3.30 |
| InChI=1/C31H38O9/c1-15-13-31-27(38-19(5)33)16(2)14-30(31,40-31)26(35)17(3)24(37-18(4)32)21-22(29(21,6)7)25(23(15)34)39-28(36)20-11-9-8-10-12-20/h8-13,16-17,21-25,27,34H,14H2,1-7H3/b15-13-/t16-,17+,21-,22+,23+,24-,25+,27-,30-,31-/m0/s1 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.51% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.02% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.43% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.60% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.28% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.34% | 91.49% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 89.75% | 83.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.18% | 91.11% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 86.60% | 81.11% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 84.87% | 97.79% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.46% | 85.14% |
| CHEMBL5028 | O14672 | ADAM10 | 84.41% | 97.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.98% | 89.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.36% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Euphorbia antiquorum |
| PubChem | 21636312 |
| LOTUS | LTS0213442 |
| wikiData | Q105347849 |