Yesanchinoside F
| Internal ID | 89572f0c-c42c-4207-8b4e-36365772eacc |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-[[(3S,5R,6S,8R,9R,10R,12R,13R,14R,17S)-3,12-dihydroxy-4,4,8,10,14-pentamethyl-17-[(2S)-6-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyhept-5-en-2-yl]-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]oxy]-3,4-dihydroxy-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3CC4(C(CC(C5C4(CCC5C(C)(CCC=C(C)C)OC6C(C(C(C(O6)COC7C(C(C(C(O7)CO)O)O)O)O)O)O)C)O)C8(C3C(C(CC8)O)(C)C)C)C)COC(=O)C)O)O)O)O)O |
| SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2O[C@H]3C[C@@]4([C@H](C[C@H]([C@H]5[C@]4(CC[C@@H]5[C@](C)(CCC=C(C)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O)O)O)C)O)[C@@]8([C@@H]3C([C@H](CC8)O)(C)C)C)C)COC(=O)C)O)O)O)O)O |
| InChI | InChI=1S/C56H94O24/c1-23(2)12-11-15-56(10,80-50-45(71)41(67)37(63)31(77-50)22-73-48-43(69)40(66)36(62)29(20-57)76-48)26-13-17-54(8)34(26)27(59)18-32-53(7)16-14-33(60)52(5,6)47(53)28(19-55(32,54)9)75-51-46(42(68)38(64)30(78-51)21-72-25(4)58)79-49-44(70)39(65)35(61)24(3)74-49/h12,24,26-51,57,59-71H,11,13-22H2,1-10H3/t24-,26-,27+,28-,29+,30+,31+,32+,33-,34-,35-,36+,37+,38+,39+,40-,41-,42-,43+,44+,45+,46+,47-,48+,49-,50-,51+,53+,54+,55+,56-/m0/s1 |
| InChI Key | SNPBSTALMDUCRQ-GYDRUNPJSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C56H94O24 |
| Molecular Weight | 1151.30 g/mol |
| Exact Mass | 1150.61350386 g/mol |
| Topological Polar Surface Area (TPSA) | 383.00 Ų |
| XlogP | -0.60 |
| (+)-Yesanchinoside F |
| SNPBSTALMDUCRQ-GYDRUNPJSA- |
| InChI=1/C56H94O24/c1-23(2)12-11-15-56(10,80-50-45(71)41(67)37(63)31(77-50)22-73-48-43(69)40(66)36(62)29(20-57)76-48)26-13-17-54(8)34(26)27(59)18-32-53(7)16-14-33(60)52(5,6)47(53)28(19-55(32,54)9)75-51-46(42(68)38(64)30(78-51)21-72-25(4)58)79-49-44(70)39(6 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.90% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.50% | 91.11% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 95.64% | 96.61% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.11% | 86.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.82% | 97.09% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 94.57% | 97.36% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 93.28% | 95.93% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.54% | 96.09% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 91.62% | 95.50% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 90.90% | 95.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.90% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.81% | 89.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.19% | 94.45% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 87.12% | 96.90% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.29% | 95.89% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.94% | 92.50% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.44% | 98.95% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.91% | 100.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.81% | 95.89% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.08% | 100.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.30% | 92.94% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.91% | 94.75% |
| CHEMBL5028 | O14672 | ADAM10 | 81.77% | 97.50% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.49% | 94.33% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.99% | 96.77% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.94% | 91.24% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 80.25% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Panax japonicus |
| PubChem | 11018665 |
| LOTUS | LTS0124007 |
| wikiData | Q105256608 |