Yesanchinoside E
| Internal ID | a945db7f-4002-4950-99ff-258a1340834a |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | (2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5S,6R)-2-[[(3S,5R,6S,8R,9R,10R,12R,13R,14R,17S)-3,12-dihydroxy-4,4,8,10,14-pentamethyl-17-[(2S)-6-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyhept-5-en-2-yl]-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]oxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3CC4(C(CC(C5C4(CCC5C(C)(CCC=C(C)C)OC6C(C(C(C(O6)COC7C(C(C(C(O7)CO)O)O)O)O)O)O)C)O)C8(C3C(C(CC8)O)(C)C)C)C)CO)O)O)O)O)O |
| SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2O[C@H]3C[C@@]4([C@H](C[C@H]([C@H]5[C@]4(CC[C@@H]5[C@](C)(CCC=C(C)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O)O)O)C)O)[C@@]8([C@@H]3C([C@H](CC8)O)(C)C)C)C)CO)O)O)O)O)O |
| InChI | InChI=1S/C54H92O23/c1-22(2)11-10-14-54(9,77-48-43(69)39(65)36(62)29(75-48)21-70-46-41(67)38(64)34(60)27(19-55)73-46)24-12-16-52(7)32(24)25(57)17-30-51(6)15-13-31(58)50(4,5)45(51)26(18-53(30,52)8)72-49-44(40(66)35(61)28(20-56)74-49)76-47-42(68)37(63)33(59)23(3)71-47/h11,23-49,55-69H,10,12-21H2,1-9H3/t23-,24-,25+,26-,27+,28+,29+,30+,31-,32-,33-,34+,35+,36+,37+,38-,39-,40-,41+,42+,43+,44+,45-,46+,47-,48-,49+,51+,52+,53+,54-/m0/s1 |
| InChI Key | BKQLBIWHYYCPJF-TVSWXRPVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C54H92O23 |
| Molecular Weight | 1109.30 g/mol |
| Exact Mass | 1108.60293918 g/mol |
| Topological Polar Surface Area (TPSA) | 377.00 Ų |
| XlogP | -0.60 |
| (+)-Yesanchinoside E |
| BKQLBIWHYYCPJF-TVSWXRPVSA- |
| InChI=1/C54H92O23/c1-22(2)11-10-14-54(9,77-48-43(69)39(65)36(62)29(75-48)21-70-46-41(67)38(64)34(60)27(19-55)73-46)24-12-16-52(7)32(24)25(57)17-30-51(6)15-13-31(58)50(4,5)45(51)26(18-53(30,52)8)72-49-44(40(66)35(61)28(20-56)74-49)76-47-42(68)37(63)33(59)2 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.04% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.26% | 97.25% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 96.37% | 95.93% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 95.51% | 97.36% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.38% | 97.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.52% | 86.33% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.92% | 96.61% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 91.76% | 95.50% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 91.14% | 95.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.63% | 92.94% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.53% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.11% | 95.89% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.43% | 96.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.21% | 94.75% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 87.92% | 91.49% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 85.28% | 95.38% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 85.25% | 96.90% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.15% | 89.00% |
| CHEMBL1977 | P11473 | Vitamin D receptor | 84.53% | 99.43% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.70% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.44% | 98.95% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 82.09% | 100.00% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 81.99% | 95.58% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.90% | 95.89% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.89% | 95.83% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.54% | 94.45% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.26% | 100.00% |
| CHEMBL4105786 | P41182 | B-cell lymphoma 6 protein | 81.12% | 92.86% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Panax japonicus |
| PubChem | 11136943 |
| LOTUS | LTS0218447 |
| wikiData | Q104937729 |