Yahbldhtfhrzog-xzjbwwcgsa-
Internal ID | f905ae01-f554-4f1d-99cf-6bb215d830b1 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | [(1S,2S,4S,5S,6R,10S)-5-[(2S,3R,4R,5R,6S)-3,5-diacetyloxy-4-hydroxy-6-methyloxan-2-yl]oxy-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-2-yl]methyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C3C=COC(C3C4(C2O4)COC(=O)C=CC5=CC(=C(C=C5)O)OC)OC6C(C(C(C(O6)CO)O)O)O)OC(=O)C)O)OC(=O)C |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@H]2[C@@H]3C=CO[C@H]([C@@H]3[C@@]4([C@H]2O4)COC(=O)/C=C/C5=CC(=C(C=C5)O)OC)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)OC(=O)C)O)OC(=O)C |
InChI | InChI=1S/C35H44O19/c1-14-28(49-15(2)37)27(44)30(50-16(3)38)34(48-14)52-29-18-9-10-46-32(53-33-26(43)25(42)24(41)21(12-36)51-33)23(18)35(31(29)54-35)13-47-22(40)8-6-17-5-7-19(39)20(11-17)45-4/h5-11,14,18,21,23-34,36,39,41-44H,12-13H2,1-4H3/b8-6+/t14-,18+,21+,23+,24+,25-,26+,27+,28-,29-,30+,31-,32-,33-,34-,35+/m0/s1 |
InChI Key | YAHBLDHTFHRZOG-XZJBWWCGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H44O19 |
Molecular Weight | 768.70 g/mol |
Exact Mass | 768.24767917 g/mol |
Topological Polar Surface Area (TPSA) | 268.00 Ų |
XlogP | -0.90 |
YAHBLDHTFHRZOG-XZJBWWCGSA- |
InChI=1/C35H44O19/c1-14-28(49-15(2)37)27(44)30(50-16(3)38)34(48-14)52-29-18-9-10-46-32(53-33-26(43)25(42)24(41)21(12-36)51-33)23(18)35(31(29)54-35)13-47-22(40)8-6-17-5-7-19(39)20(11-17)45-4/h5-11,14,18,21,23-34,36,39,41-44H,12-13H2,1-4H3/b8-6+/t14-,18+,21 |
![2D Structure of Yahbldhtfhrzog-xzjbwwcgsa- 2D Structure of Yahbldhtfhrzog-xzjbwwcgsa-](https://plantaedb.com/storage/docs/compounds/2023/11/yahbldhtfhrzog-xzjbwwcgsa-.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.82% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 99.16% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.16% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.03% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.95% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.45% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.73% | 95.56% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 92.82% | 97.36% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.26% | 92.94% |
CHEMBL3194 | P02766 | Transthyretin | 89.32% | 90.71% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 88.07% | 80.78% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.85% | 94.73% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.57% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.89% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.40% | 94.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.26% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.65% | 94.45% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.22% | 94.75% |
CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 82.01% | 98.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.69% | 86.92% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.70% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.25% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gmelina arborea |
PubChem | 21635724 |
LOTUS | LTS0220575 |
wikiData | Q105345390 |