Xylaritriol
| Internal ID | da584c8f-e462-4cc4-b233-07f211528f94 |
| Taxonomy | Organoheterocyclic compounds > Oxanes |
| IUPAC Name | (3S)-5-[(2R,3S,6S)-6-ethenyl-3-hydroxy-2,6-dimethyloxan-2-yl]-2-methylpentane-2,3-diol |
| SMILES (Canonical) | CC1(CCC(C(O1)(C)CCC(C(C)(C)O)O)O)C=C |
| SMILES (Isomeric) | C[C@]1(CC[C@@H]([C@@](O1)(C)CC[C@@H](C(C)(C)O)O)O)C=C |
| InChI | InChI=1S/C15H28O4/c1-6-14(4)9-7-12(17)15(5,19-14)10-8-11(16)13(2,3)18/h6,11-12,16-18H,1,7-10H2,2-5H3/t11-,12-,14+,15+/m0/s1 |
| InChI Key | QVKJPMMTEFECKB-DDHJSBNISA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.19875937 g/mol |
| Topological Polar Surface Area (TPSA) | 69.90 Ų |
| XlogP | 1.10 |
| RefChem:195482 |
| CHEBI:209308 |
| (3S)-5-[(2R,3S,6S)-6-ethenyl-3-hydroxy-2,6-dimethyloxan-2-yl]-2-methylpentane-2,3-diol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.28% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.14% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.46% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.32% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.92% | 98.95% |
| CHEMBL233 | P35372 | Mu opioid receptor | 88.17% | 97.93% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 87.46% | 98.05% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.52% | 85.14% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.61% | 92.88% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 84.39% | 90.24% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 82.73% | 100.00% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 82.35% | 97.05% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.17% | 97.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.90% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.20% | 100.00% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 80.58% | 94.78% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.32% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.26% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139588203 |
| LOTUS | LTS0131124 |
| wikiData | Q105228708 |