Xantholysin A
| Internal ID | 2d84dda3-7eb8-417d-876f-c6c474c77ef2 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | 5-[[5-amino-1-[[1-[[1-[[5-amino-1-[[6,15-bis(3-amino-3-oxopropyl)-3-butan-2-yl-9,12,18-tris(2-methylpropyl)-2,5,8,11,14,17,20,23-octaoxo-21-propan-2-yl-1-oxa-4,7,10,13,16,19,22-heptazacyclopentacos-24-yl]amino]-1,5-dioxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-4-[[2-(3-hydroxydecanoylamino)-4-methylpentanoyl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | CCCCCCCC(CC(=O)NC(CC(C)C)C(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)N)C(=O)NC(C(C)C)C(=O)NC(CC(C)C)C(=O)NC(CCC(=O)N)C(=O)NC1COC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)C(C)C)CC(C)C)CCC(=O)N)CC(C)C)CC(C)C)CCC(=O)N)C(C)CC)O |
| SMILES (Isomeric) | CCCCCCCC(CC(=O)NC(CC(C)C)C(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)N)C(=O)NC(C(C)C)C(=O)NC(CC(C)C)C(=O)NC(CCC(=O)N)C(=O)NC1COC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)C(C)C)CC(C)C)CCC(=O)N)CC(C)C)CC(C)C)CCC(=O)N)C(C)CC)O |
| InChI | InChI=1S/C84H146N18O23/c1-18-20-21-22-23-24-50(103)40-66(108)89-56(35-42(3)4)76(116)94-55(29-34-67(109)110)71(111)90-53(27-32-64(87)106)74(114)100-68(47(13)14)82(122)97-60(39-46(11)12)79(119)92-52(26-31-63(86)105)73(113)99-61-41-125-84(124)70(49(17)19-2)102-75(115)54(28-33-65(88)107)93-77(117)57(36-43(5)6)96-80(120)58(37-44(7)8)95-72(112)51(25-30-62(85)104)91-78(118)59(38-45(9)10)98-83(123)69(48(15)16)101-81(61)121/h42-61,68-70,103H,18-41H2,1-17H3,(H2,85,104)(H2,86,105)(H2,87,106)(H2,88,107)(H,89,108)(H,90,111)(H,91,118)(H,92,119)(H,93,117)(H,94,116)(H,95,112)(H,96,120)(H,97,122)(H,98,123)(H,99,113)(H,100,114)(H,101,121)(H,102,115)(H,109,110) |
| InChI Key | CNAFSPBMMDALIS-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C84H146N18O23 |
| Molecular Weight | 1776.20 g/mol |
| Exact Mass | 1775.08082298 g/mol |
| Topological Polar Surface Area (TPSA) | 664.00 Ų |
| XlogP | 3.40 |
| Atomic LogP (AlogP) | -1.04 |
| H-Bond Acceptor | 22 |
| H-Bond Donor | 20 |
| Rotatable Bonds | 50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.4739 | 47.39% |
| Caco-2 | - | 0.8573 | 85.73% |
| Blood Brain Barrier | - | 0.8750 | 87.50% |
| Human oral bioavailability | - | 0.6571 | 65.71% |
| Subcellular localzation | Mitochondria | 0.5209 | 52.09% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8393 | 83.93% |
| OATP1B3 inhibitior | + | 0.8816 | 88.16% |
| MATE1 inhibitior | - | 0.9600 | 96.00% |
| OCT2 inhibitior | - | 0.9000 | 90.00% |
| BSEP inhibitior | + | 0.9472 | 94.72% |
| P-glycoprotein inhibitior | + | 0.7418 | 74.18% |
| P-glycoprotein substrate | + | 0.8865 | 88.65% |
| CYP3A4 substrate | + | 0.7212 | 72.12% |
| CYP2C9 substrate | - | 0.5928 | 59.28% |
| CYP2D6 substrate | - | 0.8621 | 86.21% |
| CYP3A4 inhibition | - | 0.6052 | 60.52% |
| CYP2C9 inhibition | - | 0.9389 | 93.89% |
| CYP2C19 inhibition | - | 0.9278 | 92.78% |
| CYP2D6 inhibition | - | 0.9299 | 92.99% |
| CYP1A2 inhibition | - | 0.9345 | 93.45% |
| CYP2C8 inhibition | + | 0.6944 | 69.44% |
| CYP inhibitory promiscuity | - | 0.9881 | 98.81% |
| UGT catelyzed | - | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8500 | 85.00% |
| Carcinogenicity (trinary) | Non-required | 0.6390 | 63.90% |
| Eye corrosion | - | 0.9855 | 98.55% |
| Eye irritation | - | 0.8954 | 89.54% |
| Skin irritation | - | 0.7942 | 79.42% |
| Skin corrosion | - | 0.9352 | 93.52% |
| Ames mutagenesis | - | 0.7537 | 75.37% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7039 | 70.39% |
| Micronuclear | + | 0.8000 | 80.00% |
| Hepatotoxicity | - | 0.5323 | 53.23% |
| skin sensitisation | - | 0.8685 | 86.85% |
| Respiratory toxicity | + | 0.7556 | 75.56% |
| Reproductive toxicity | + | 0.7444 | 74.44% |
| Mitochondrial toxicity | + | 0.7875 | 78.75% |
| Nephrotoxicity | + | 0.5134 | 51.34% |
| Acute Oral Toxicity (c) | III | 0.7190 | 71.90% |
| Estrogen receptor binding | - | 0.4751 | 47.51% |
| Androgen receptor binding | + | 0.7357 | 73.57% |
| Thyroid receptor binding | + | 0.7092 | 70.92% |
| Glucocorticoid receptor binding | + | 0.7834 | 78.34% |
| Aromatase binding | + | 0.7941 | 79.41% |
| PPAR gamma | + | 0.7877 | 78.77% |
| Honey bee toxicity | - | 0.7478 | 74.78% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | + | 0.5565 | 55.65% |
| Fish aquatic toxicity | + | 0.6808 | 68.08% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.92% | 98.95% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 99.84% | 94.45% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.68% | 96.61% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 98.04% | 95.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 97.96% | 93.56% |
| CHEMBL4801 | P29466 | Caspase-1 | 97.83% | 96.85% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.83% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.71% | 96.09% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 97.64% | 96.47% |
| CHEMBL236 | P41143 | Delta opioid receptor | 97.11% | 99.35% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.67% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.48% | 91.11% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 96.21% | 94.66% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 95.93% | 96.11% |
| CHEMBL1801 | P00747 | Plasminogen | 95.61% | 92.44% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 95.49% | 90.08% |
| CHEMBL3776 | Q14790 | Caspase-8 | 95.45% | 97.06% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.32% | 97.09% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 95.27% | 97.23% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 94.09% | 96.00% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 93.95% | 98.03% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 93.80% | 90.24% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 92.89% | 89.50% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.79% | 97.25% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 92.75% | 98.94% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 92.71% | 98.05% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 92.67% | 92.08% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 92.61% | 100.00% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 92.54% | 88.42% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 91.91% | 93.00% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 91.69% | 92.32% |
| CHEMBL3468 | P55210 | Caspase-7 | 91.62% | 95.68% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 91.48% | 95.20% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.36% | 90.71% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 91.34% | 95.71% |
| CHEMBL4662 | P28074 | Proteasome Macropain subunit MB1 | 91.20% | 93.85% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 91.16% | 95.50% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 91.10% | 98.33% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 90.65% | 96.90% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.09% | 90.17% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 89.89% | 94.55% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.83% | 97.29% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.22% | 94.75% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 88.58% | 100.00% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 88.47% | 95.38% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 88.28% | 91.81% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 86.96% | 97.64% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.59% | 96.00% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 86.24% | 89.63% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.24% | 97.14% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 85.67% | 97.50% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.28% | 100.00% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 84.59% | 97.00% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 84.02% | 96.33% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.51% | 95.89% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.01% | 90.20% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.65% | 100.00% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.33% | 94.80% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 81.66% | 92.50% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 81.49% | 93.10% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 81.36% | 82.38% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 81.17% | 97.79% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.83% | 91.19% |
| CHEMBL1949 | P62937 | Cyclophilin A | 80.67% | 98.57% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 80.54% | 95.56% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.50% | 95.56% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.27% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 145720589 |
| LOTUS | LTS0249230 |
| wikiData | Q103817878 |