Withalongolide M
| Internal ID | 7e120fba-b8a0-4b0c-9625-c1aad741b5d9 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
| IUPAC Name | (2R)-2-[(1S)-1-[(3R,8S,9S,13S,14S,17R)-3-hydroxy-13-methyl-1-oxo-3,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-2H-cyclopenta[a]phenanthren-17-yl]ethyl]-5-methyl-4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-2,3-dihydropyran-6-one |
| SMILES (Canonical) | CC1=C(CC(OC1=O)C(C)C2CCC3C2(CCC4C3CCC5=C4C(=O)CC(C5)O)C)COC6C(C(C(C(O6)CO)O)O)O |
| SMILES (Isomeric) | CC1=C(C[C@@H](OC1=O)[C@@H](C)[C@H]2CC[C@@H]3[C@@]2(CC[C@H]4[C@H]3CCC5=C4C(=O)C[C@@H](C5)O)C)CO[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O |
| InChI | InChI=1S/C33H48O10/c1-15-18(14-41-32-30(39)29(38)28(37)26(13-34)43-32)11-25(42-31(15)40)16(2)22-6-7-23-20-5-4-17-10-19(35)12-24(36)27(17)21(20)8-9-33(22,23)3/h16,19-23,25-26,28-30,32,34-35,37-39H,4-14H2,1-3H3/t16-,19+,20+,21-,22+,23-,25+,26+,28+,29-,30+,32+,33+/m0/s1 |
| InChI Key | CLUVBNATYXEVRS-UJQMTUMNSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C33H48O10 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.32474772 g/mol |
| Topological Polar Surface Area (TPSA) | 163.00 Ų |
| XlogP | 2.00 |
| CHEBI:69117 |
| CHEMBL1934465 |
| DTXSID201107972 |
| Q27137458 |
| 28-O-beta-D-glucopyranosyl-3beta-hydroxy-1-oxo-19-norwitha-5-(10),24-dienolide |
| [(2R)-2-{(1S)-1-[(3beta,17beta)-3-hydroxy-1-oxoestr-5(10)-en-17-yl]ethyl}-5-methyl-6-oxo-3,6-dihydro-2H-pyran-4-yl]methyl beta-D-glucopyranoside |
| 1350448-54-2 |
| 19-Norergosta-5(10),24-dien-26-oic acid, 28-(beta-D-glucopyranosyloxy)-3,22-dihydroxy-1-oxo-, delta-lactone, (3beta,22R)- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.24% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.83% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.46% | 94.45% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 93.44% | 95.93% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.14% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.88% | 96.09% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 92.65% | 96.38% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.41% | 85.14% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.79% | 95.89% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 91.33% | 97.33% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.41% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.13% | 95.56% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.04% | 96.47% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.90% | 99.23% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.26% | 97.14% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.91% | 95.89% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.67% | 96.21% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 84.52% | 89.05% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.16% | 92.50% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.34% | 97.25% |
| CHEMBL204 | P00734 | Thrombin | 82.80% | 96.01% |
| CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 82.77% | 95.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.36% | 86.33% |
| CHEMBL233 | P35372 | Mu opioid receptor | 81.70% | 97.93% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.57% | 95.38% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.28% | 93.04% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.93% | 96.61% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.73% | 90.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Physalis longifolia |
| Psidium guajava |
| PubChem | 56926294 |
| LOTUS | LTS0046783 |
| wikiData | Q105188694 |