Wewakazole
| Internal ID | 26f126f4-701d-4413-bf85-78161fb119b5 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | (4S,11S,17S,20S,27S,33S,39S,45S)-4,11-dibenzyl-20-[(2S)-butan-2-yl]-27,48-dimethyl-45-propan-2-yl-6,22,47-trioxa-3,10,13,19,26,29,35,41,44,49,50,51-dodecazaheptacyclo[44.2.1.15,8.121,24.013,17.029,33.035,39]henpentaconta-1(48),5(51),7,21(50),23,46(49)-hexaene-2,9,12,18,25,28,34,40,43-nonone |
| SMILES (Canonical) | CCC(C)C1C2=NC(=CO2)C(=O)NC(C(=O)N3CCCC3C(=O)N4CCCC4C(=O)NCC(=O)NC(C5=NC(=C(O5)C)C(=O)NC(C6=NC(=CO6)C(=O)NC(C(=O)N7CCCC7C(=O)N1)CC8=CC=CC=C8)CC9=CC=CC=C9)C(C)C)C |
| SMILES (Isomeric) | CC[C@H](C)[C@H]1C2=NC(=CO2)C(=O)N[C@H](C(=O)N3CCC[C@H]3C(=O)N4CCC[C@H]4C(=O)NCC(=O)N[C@H](C5=NC(=C(O5)C)C(=O)N[C@H](C6=NC(=CO6)C(=O)N[C@H](C(=O)N7CCC[C@H]7C(=O)N1)CC8=CC=CC=C8)CC9=CC=CC=C9)C(C)C)C |
| InChI | InChI=1S/C59H72N12O12/c1-7-33(4)47-55-65-40(31-82-55)49(73)61-34(5)57(78)71-26-16-23-44(71)59(80)70-25-14-21-42(70)51(75)60-29-45(72)66-46(32(2)3)56-68-48(35(6)83-56)53(77)62-38(27-36-17-10-8-11-18-36)54-64-41(30-81-54)50(74)63-39(28-37-19-12-9-13-20-37)58(79)69-24-15-22-43(69)52(76)67-47/h8-13,17-20,30-34,38-39,42-44,46-47H,7,14-16,21-29H2,1-6H3,(H,60,75)(H,61,73)(H,62,77)(H,63,74)(H,66,72)(H,67,76)/t33-,34-,38-,39-,42-,43-,44-,46-,47-/m0/s1 |
| InChI Key | LRFQMOZAQWOOPZ-IBFZZIGPSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C59H72N12O12 |
| Molecular Weight | 1141.30 g/mol |
| Exact Mass | 1140.53926578 g/mol |
| Topological Polar Surface Area (TPSA) | 314.00 Ų |
| XlogP | 4.70 |
| DTXSID801046508 |
| RefChem:194821 |
| DTXCID301528333 |
| (12S,32S,82Z,122S,172Z,212Z,5S,9S,14S,18S,22S)-14,18-dibenzyl-9-((S)-sec-butyl)-22-isopropyl-215,5-dimethyl-6,10,15,19,23,26-hexaaza-8,17,21(4,2)-trioxazola-1(1,2),3,12(2,1)-tripyrrolidinacycloheptacosaphane-2,4,7,11,13,16,20,24,27-nonaone |
| (4S,11S,17S,20S,27S,33S,39S,45S)-4,11-dibenzyl-20-((2S)-butan-2-yl)-27,48-dimethyl-45-propan-2-yl-6,22,47-trioxa-3,10,13,19,26,29,35,41,44,49,50,51-dodecazaheptacyclo(44.2.1.15,8.121,24.013,17.029,33.035,39)henpentaconta-1(48),5(51),7,21(50),23,46(49)-hexaene-2,9,12,18,25,28,34,40,43-nonone |
| 494798-69-5 |
| CHEMBL1669190 |
| CHEBI:70163 |
| Q27138505 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.81% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.77% | 85.14% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 95.74% | 97.64% |
| CHEMBL4447 | Q9Y337 | Kallikrein 5 | 93.71% | 87.50% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.42% | 86.33% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 92.44% | 93.03% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 92.14% | 92.97% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 92.01% | 93.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.81% | 97.09% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 91.55% | 82.38% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 91.18% | 91.71% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.88% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.48% | 99.23% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 89.35% | 99.18% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.68% | 95.56% |
| CHEMBL1801 | P00747 | Plasminogen | 88.17% | 92.44% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.96% | 95.50% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.18% | 90.08% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.89% | 94.00% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 85.04% | 96.39% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.72% | 95.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.29% | 90.71% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 82.80% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.69% | 94.73% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 82.45% | 95.34% |
| CHEMBL2189110 | Q15910 | Histone-lysine N-methyltransferase EZH2 | 82.19% | 97.50% |
| CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 81.82% | 96.69% |
| CHEMBL4071 | P08311 | Cathepsin G | 81.69% | 94.64% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 81.27% | 97.53% |
| CHEMBL2916 | O14746 | Telomerase reverse transcriptase | 80.72% | 90.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.42% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 21578002 |
| LOTUS | LTS0134260 |
| wikiData | Q27138505 |