Vittacarboline
| Internal ID | 6ddbad52-b686-46d3-9f75-54ad5311662c |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyridoindoles > Beta carbolines |
| IUPAC Name | 9-[(5-methylfuran-2-yl)methyl]pyrido[3,4-b]indole |
| SMILES (Canonical) | CC1=CC=C(O1)CN2C3=CC=CC=C3C4=C2C=NC=C4 |
| SMILES (Isomeric) | CC1=CC=C(O1)CN2C3=CC=CC=C3C4=C2C=NC=C4 |
| InChI | InChI=1S/C17H14N2O/c1-12-6-7-13(20-12)11-19-16-5-3-2-4-14(16)15-8-9-18-10-17(15)19/h2-10H,11H2,1H3 |
| InChI Key | UANUGMASRPSVFK-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.110613074 g/mol |
| Topological Polar Surface Area (TPSA) | 31.00 Ų |
| XlogP | 3.40 |
| 9-[(5-methylfuran-2-yl)methyl]pyrido[3,4-b]indole |
| InChI=1/C17H14N2O/c1-12-6-7-13(20-12)11-19-16-5-3-2-4-14(16)15-8-9-18-10-17(15)19/h2-10H,11H2,1H |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 94.21% | 93.65% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 92.94% | 98.59% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 92.73% | 96.47% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 92.44% | 93.24% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.94% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.66% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.32% | 89.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 84.41% | 93.10% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.94% | 85.14% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 83.36% | 93.81% |
| CHEMBL1741221 | Q9Y4P1 | Cysteine protease ATG4B | 83.04% | 87.50% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.71% | 100.00% |
| CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 82.61% | 88.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.40% | 96.09% |
| CHEMBL2094121 | P14867 | GABA-A receptor; alpha-1/beta-3/gamma-2 | 82.11% | 95.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.00% | 99.23% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.62% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.79% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Hippeastrum vittatum |
| PubChem | 11807483 |
| LOTUS | LTS0201940 |
| wikiData | Q105268940 |