Vismione B
| Internal ID | 90dadb08-fca1-4c2d-b59b-c337f54e671b |
| Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
| IUPAC Name | 9,12-dihydroxy-5-methoxy-2,2,9-trimethyl-8,10-dihydronaphtho[6,7-h]chromen-11-one |
| SMILES (Canonical) | CC1(C=CC2=C(O1)C3=C(C4=C(CC(CC4=O)(C)O)C=C3C=C2OC)O)C |
| SMILES (Isomeric) | CC1(C=CC2=C(O1)C3=C(C4=C(CC(CC4=O)(C)O)C=C3C=C2OC)O)C |
| InChI | InChI=1S/C21H22O5/c1-20(2)6-5-13-15(25-4)8-11-7-12-9-21(3,24)10-14(22)16(12)18(23)17(11)19(13)26-20/h5-8,23-24H,9-10H2,1-4H3 |
| InChI Key | RUKXXSDGTORZFO-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.14672380 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 3.60 |
| CHEMBL486405 |
| SCHEMBL5024985 |
| 9,12-dihydroxy-5-methoxy-2,2,9-trimethyl-8,10-dihydronaphtho[6,7-h]chromen-11-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.65% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.07% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.39% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.14% | 94.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.71% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.75% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.85% | 90.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.66% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.60% | 93.99% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 86.69% | 80.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.68% | 94.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.50% | 95.56% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.48% | 92.94% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.46% | 96.21% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.33% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.21% | 99.23% |
| CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 83.12% | 98.00% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 82.33% | 94.42% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.78% | 89.50% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.47% | 98.75% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.04% | 91.07% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.89% | 95.89% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.44% | 99.17% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.21% | 100.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.12% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cratoxylum cochinchinense |
| Cratoxylum sumatranum |
| Vismia baccifera |
| Vismia japurensis |
| PubChem | 10247551 |
| LOTUS | LTS0077046 |
| wikiData | Q104397366 |