Viridobrunnine A
| Internal ID | 5877ced2-3461-4a93-af9a-2b22d88976f8 |
| Taxonomy | Organoheterocyclic compounds > Benzoxazines > Phenoxazines |
| IUPAC Name | (8-acetamido-7-oxophenoxazin-2-yl)methyl acetate |
| SMILES (Canonical) | CC(=O)NC1=CC2=NC3=C(C=CC(=C3)COC(=O)C)OC2=CC1=O |
| SMILES (Isomeric) | CC(=O)NC1=CC2=NC3=C(C=CC(=C3)COC(=O)C)OC2=CC1=O |
| InChI | InChI=1S/C17H14N2O5/c1-9(20)18-12-6-14-17(7-15(12)22)24-16-4-3-11(5-13(16)19-14)8-23-10(2)21/h3-7H,8H2,1-2H3,(H,18,20) |
| InChI Key | BPAVCXXWVSONAZ-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.09027155 g/mol |
| Topological Polar Surface Area (TPSA) | 94.10 Ų |
| XlogP | 0.60 |
| (8-acetamido-7-oxophenoxazin-2-yl)methyl acetate |
| RefChem:194460 |
| CHEBI:211541 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.90% | 85.14% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 97.52% | 87.67% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 96.96% | 94.73% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 96.71% | 81.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.95% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.61% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.69% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.13% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.45% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.74% | 94.45% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.79% | 95.50% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 85.65% | 94.42% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 85.15% | 95.71% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 82.96% | 97.53% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.67% | 91.49% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.56% | 89.34% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.78% | 89.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.65% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 132517362 |
| LOTUS | LTS0186332 |
| wikiData | Q77493395 |