Virgatolide B
| Internal ID | 3d1a2dc4-dcf3-4ee5-b673-6e9a0662fe53 |
| Taxonomy | Organoheterocyclic compounds > Benzofurans > Benzofuranones |
| IUPAC Name | (2R,3S,4'R,6'S,8S)-4',5-dihydroxy-8-[(1S)-1-hydroxyethyl]-3,6'-dimethylspiro[4,8-dihydro-3H-furo[3,4-g]chromene-2,2'-oxane]-6-one |
| SMILES (Canonical) | CC1CC(CC2(O1)C(CC3=C(O2)C=C4C(OC(=O)C4=C3O)C(C)O)C)O |
| SMILES (Isomeric) | C[C@H]1C[C@H](C[C@]2(O1)[C@H](CC3=C(O2)C=C4[C@H](OC(=O)C4=C3O)[C@H](C)O)C)O |
| InChI | InChI=1S/C19H24O7/c1-8-4-12-14(26-19(8)7-11(21)5-9(2)25-19)6-13-15(16(12)22)18(23)24-17(13)10(3)20/h6,8-11,17,20-22H,4-5,7H2,1-3H3/t8-,9-,10-,11+,17+,19+/m0/s1 |
| InChI Key | FZIVPEMPRYZJDQ-LPMIWMRZSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.15220310 g/mol |
| Topological Polar Surface Area (TPSA) | 105.00 Ų |
| XlogP | 2.30 |
| RefChem:194425 |
| (2R,3S,4'R,6'S,8S)-4',5-dihydroxy-8-((1S)-1-hydroxyethyl)-3,6'-dimethylspiro(4,8-dihydro-3H-furo(3,4-g)chromene-2,2'-oxane)-6-one |
| CHEBI:203989 |
| (2R,3S,4'R,6'S,8S)-4',5-dihydroxy-8-[(1S)-1-hydroxyethyl]-3,6'-dimethylspiro[4,8-dihydro-3H-uro[3,4-g]chromene-2,2'-oxane]-6-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.34% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.92% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.91% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.33% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.90% | 89.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.78% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.58% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.99% | 95.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.92% | 90.71% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.14% | 97.25% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.00% | 93.56% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 85.08% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.86% | 95.89% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.70% | 99.23% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 83.95% | 91.49% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.25% | 90.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.66% | 91.07% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.99% | 93.40% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.69% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 53307030 |
| LOTUS | LTS0086138 |
| wikiData | Q77382650 |