Virescenoside Z17
| Internal ID | cb76e515-0ff8-4f3a-ae02-d1c75cc9f9af |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
| IUPAC Name | butyl (2S,3S,4R,5S,6R)-6-[[(1S,2R,3R,4aR,7S,10aR)-7-ethenyl-2,3-dihydroxy-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-1-yl]methoxy]-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES (Canonical) | CCCCOC(=O)C1C(C(C(C(O1)OCC2(C3CC=C4CC(CCC4C3(CC(C2O)O)C)(C)C=C)C)O)O)O |
| SMILES (Isomeric) | CCCCOC(=O)[C@@H]1[C@H]([C@H]([C@@H]([C@@H](O1)OC[C@@]2([C@@H]3CC=C4C[C@@](CCC4[C@]3(C[C@H]([C@@H]2O)O)C)(C)C=C)C)O)O)O |
| InChI | InChI=1S/C30H48O9/c1-6-8-13-37-26(36)24-22(33)21(32)23(34)27(39-24)38-16-30(5)20-10-9-17-14-28(3,7-2)12-11-18(17)29(20,4)15-19(31)25(30)35/h7,9,18-25,27,31-35H,2,6,8,10-16H2,1,3-5H3/t18?,19-,20-,21-,22+,23+,24+,25+,27-,28+,29-,30-/m1/s1 |
| InChI Key | WKZOLSGWPUVAEN-KNPGLHBASA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C30H48O9 |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.32983310 g/mol |
| Topological Polar Surface Area (TPSA) | 146.00 Ų |
| XlogP | 3.30 |
| butyl (2S,3S,4R,5S,6R)-6-[[(1S,2R,3R,4aR,7S,10aR)-7-ethenyl-2,3-dihydroxy-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-1-yl]methoxy]-3,4,5-trihydroxyoxane-2-carboxylate |
| Butyl (2S,3S,4R,5S,6R)-6-(((1S,2R,3R,4ar,7S,10ar)-7-ethenyl-2,3-dihydroxy-1,4a,7-trimethyl-1,2,3,4,4a,4b,5,6,7,8,10,10a-dodecahydrophenanthren-1-yl)methoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
| butyl (2S,3S,4R,5S,6R)-6-(((1S,2R,3R,4aR,7S,10aR)-7-ethenyl-2,3-dihydroxy-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-1-yl)methoxy)-3,4,5-trihydroxyoxane-2-carboxylate |
| Butyl (2S,3S,4R,5S,6R)-6-{[(1S,2R,3R,4ar,7S,10ar)-7-ethenyl-2,3-dihydroxy-1,4a,7-trimethyl-1,2,3,4,4a,4b,5,6,7,8,10,10a-dodecahydrophenanthren-1-yl]methoxy}-3,4,5-trihydroxyoxane-2-carboxylic acid |
| RefChem:194415 |
| CHEBI:209060 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.53% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.27% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.62% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.52% | 90.17% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 93.84% | 86.67% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.42% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.51% | 94.45% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.32% | 95.89% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.26% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.80% | 98.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.15% | 83.82% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.09% | 86.33% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.71% | 100.00% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.57% | 92.50% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.17% | 91.24% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 85.39% | 96.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.74% | 95.89% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.28% | 82.69% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.15% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.03% | 95.56% |
| CHEMBL279 | P35968 | Vascular endothelial growth factor receptor 2 | 83.99% | 95.52% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.40% | 100.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.25% | 91.07% |
| CHEMBL5028 | O14672 | ADAM10 | 83.01% | 97.50% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.87% | 92.62% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 82.75% | 97.53% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.37% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146683089 |
| LOTUS | LTS0095368 |
| wikiData | Q105307819 |