Viocristin
| Internal ID | 16a72af5-0a67-4974-8e64-c578ee48cda8 |
| Taxonomy | Benzenoids > Anthracenes > Anthraquinones |
| IUPAC Name | 7,10-dihydroxy-5-methoxy-2-methylanthracene-1,4-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H12O5/c1-7-3-11(18)14-10(15(7)19)5-8-4-9(17)6-12(21-2)13(8)16(14)20/h3-6,17,20H,1-2H3 |
| InChI Key | QQNGZSJGYLOVET-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.06847348 g/mol |
| Topological Polar Surface Area (TPSA) | 83.80 Ų |
| XlogP | 2.90 |
| 08X05Q974K |
| 74815-60-4 |
| UNII-08X05Q974K |
| 7,10-Dihydroxy-5-methoxy-2-methyl-1,4-anthracenedione |
| 1,4-Anthracenedione, 7,10-dihydroxy-5-methoxy-2-methyl- |
| VIOCRISTIN- |
| SCHEMBL16226430 |
| Q27896950 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.30% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.26% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.06% | 98.95% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.92% | 94.75% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.53% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.78% | 89.00% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 88.49% | 94.42% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.10% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.97% | 86.33% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 87.95% | 96.67% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.56% | 99.15% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.26% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.26% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.59% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.48% | 99.17% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 81.29% | 92.68% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.28% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 11055190 |
| LOTUS | LTS0129673 |
| wikiData | Q27896950 |