Vinylglyoxylate
| Internal ID | eaca59c0-e954-413c-aa2a-83749eef1cec |
| Taxonomy | Organic acids and derivatives > Keto acids and derivatives > Short-chain keto acids and derivatives |
| IUPAC Name | 2-oxobut-3-enoic acid |
| SMILES (Canonical) | C=CC(=O)C(=O)O |
| SMILES (Isomeric) | C=CC(=O)C(=O)O |
| InChI | InChI=1S/C4H4O3/c1-2-3(5)4(6)7/h2H,1H2,(H,6,7) |
| InChI Key | DGUBLKUCHAAUFT-UHFFFAOYSA-N |
| Popularity | 30 references in papers |
| Molecular Formula | C4H4O3 |
| Molecular Weight | 100.07 g/mol |
| Exact Mass | 100.016043985 g/mol |
| Topological Polar Surface Area (TPSA) | 54.40 Ų |
| XlogP | 0.30 |
| 2-Oxo-3-butenoic acid |
| 2-oxobut-3-enoic acid |
| 56842-76-3 |
| MFCD19231895 |
| 3-Butenoic acid, 2-oxo- |
| SCHEMBL326495 |
| SCHEMBL9879051 |
| CHEBI:74021 |
| DTXSID80205379 |
| AC9460 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4246 | P42680 | Tyrosine-protein kinase TEC | 92.46% | 82.05% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 85.85% | 83.82% |
| CHEMBL5251 | Q06187 | Tyrosine-protein kinase BTK | 84.84% | 98.51% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.67% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162804 |
| LOTUS | LTS0225460 |
| wikiData | Q27144339 |