Villalstonine
Internal ID | 4d36f56c-3717-4b3b-a895-56b25a9f4238 |
Taxonomy | Alkaloids and derivatives > Pleiocarpaman alkaloids |
IUPAC Name | methyl (27Z)-27-ethylidene-8,21,40-trimethyl-20,22-dioxa-8,25,30,40-tetrazaundecacyclo[23.11.2.16,17.124,28.01,23.03,21.04,18.07,15.09,14.023,30.031,36]tetraconta-7(15),9,11,13,31,33,35-heptaene-29-carboxylate |
SMILES (Canonical) | CC=C1CN2CCC34CC5C6CC7C8=C(CC(C6COC5(OC39C2CC1C(N9C1=CC=CC=C41)C(=O)OC)C)N7C)C1=CC=CC=C1N8C |
SMILES (Isomeric) | C/C=C/1\CN2CCC34CC5C6CC7C8=C(CC(C6COC5(OC39C2CC1C(N9C1=CC=CC=C41)C(=O)OC)C)N7C)C1=CC=CC=C1N8C |
InChI | InChI=1S/C41H48N4O4/c1-6-23-21-44-16-15-40-20-30-26-17-34-36-27(24-11-7-9-13-31(24)43(36)4)18-33(42(34)3)28(26)22-48-39(30,2)49-41(40)35(44)19-25(23)37(38(46)47-5)45(41)32-14-10-8-12-29(32)40/h6-14,25-26,28,30,33-35,37H,15-22H2,1-5H3/b23-6+ |
InChI Key | XXNYZYBYNFRERU-TXNBCWFRSA-N |
Popularity | 4 references in papers |
Molecular Formula | C41H48N4O4 |
Molecular Weight | 660.80 g/mol |
Exact Mass | 660.36755603 g/mol |
Topological Polar Surface Area (TPSA) | 59.40 Ų |
XlogP | 5.20 |
2723-56-0 |
methyl (27Z)-27-ethylidene-8,21,40-trimethyl-20,22-dioxa-8,25,30,40-tetrazaundecacyclo[23.11.2.16,17.124,28.01,23.03,21.04,18.07,15.09,14.023,30.031,36]tetraconta-7(15),9,11,13,31,33,35-heptaene-29-carboxylate |
NSC 222838 |
DTXSID801336397 |
NSC222838 |
NSC-222838 |
Q15427939 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL240 | Q12809 | HERG | 99.65% | 89.76% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 99.09% | 95.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.94% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.44% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.90% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.62% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.07% | 96.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.27% | 82.69% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.26% | 99.23% |
CHEMBL2535 | P11166 | Glucose transporter | 91.08% | 98.75% |
CHEMBL2581 | P07339 | Cathepsin D | 89.93% | 98.95% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 89.53% | 100.00% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 89.50% | 95.69% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.63% | 97.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.12% | 86.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.98% | 97.25% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 86.81% | 95.62% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 85.51% | 96.25% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 85.21% | 92.67% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.12% | 91.19% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.74% | 93.65% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.45% | 97.09% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 83.02% | 94.08% |
CHEMBL5028 | O14672 | ADAM10 | 82.65% | 97.50% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 82.25% | 96.39% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.06% | 94.62% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.09% | 95.83% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.82% | 90.00% |
CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 80.55% | 97.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alstonia angustifolia |
Alstonia macrophylla |
PubChem | 5476353 |
LOTUS | LTS0063605 |
wikiData | Q15427939 |