Vignafuran
| Internal ID | 4580f84e-096e-427c-803e-18274567ca39 |
| Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
| IUPAC Name | 3-methoxy-4-(6-methoxy-1-benzofuran-2-yl)phenol |
| SMILES (Canonical) | COC1=CC2=C(C=C1)C=C(O2)C3=C(C=C(C=C3)O)OC |
| SMILES (Isomeric) | COC1=CC2=C(C=C1)C=C(O2)C3=C(C=C(C=C3)O)OC |
| InChI | InChI=1S/C16H14O4/c1-18-12-5-3-10-7-16(20-14(10)9-12)13-6-4-11(17)8-15(13)19-2/h3-9,17H,1-2H3 |
| InChI Key | YCDZKMJZSGRQML-UHFFFAOYSA-N |
| Popularity | 14 references in papers |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 51.80 Ų |
| XlogP | 3.60 |
| 57800-41-6 |
| UNII-G9CLF6S56A |
| G9CLF6S56A |
| Phenol, 3-methoxy-4-(6-methoxy-2-benzofuranyl)- |
| CHEBI:9980 |
| CHEMBL233767 |
| 2-(4-Hydroxy-2-methoxyphenyl)-6-methoxybenzofuran |
| 3-methoxy-4-(6-methoxybenzofuran-2-yl)phenol |
| C08993 |
| DTXSID40331688 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.36% | 91.11% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 94.87% | 98.35% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.31% | 94.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.04% | 90.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.69% | 99.15% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.46% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.32% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.93% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.52% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.85% | 96.09% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 84.21% | 90.24% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.76% | 98.75% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.43% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Erythrina addisoniae |
| Lablab purpureus |
| PubChem | 441958 |
| LOTUS | LTS0149167 |
| wikiData | Q27108545 |