Viburtinal
| Internal ID | 41e04d55-3825-4c1f-991e-c7f66b349600 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Aldehydes > Aryl-aldehydes |
| IUPAC Name | 4-methylcyclopenta[c]pyran-7-carbaldehyde |
| SMILES (Canonical) | CC1=COC=C2C1=CC=C2C=O |
| SMILES (Isomeric) | CC1=COC=C2C1=CC=C2C=O |
| InChI | InChI=1S/C10H8O2/c1-7-5-12-6-10-8(4-11)2-3-9(7)10/h2-6H,1H3 |
| InChI Key | IHEBZQKYPSMVBZ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C10H8O2 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.052429494 g/mol |
| Topological Polar Surface Area (TPSA) | 30.20 Ų |
| XlogP | 1.80 |
| 4-Methylcyclopenta[c]pyran-7-carbaldehyde |
| 63661-79-0 |
| Cyclopenta(c)pyran-7-carboxaldehyde, 4-methyl- |
| Cyclopenta[c]pyran-7-carboxaldehyde, 4-methyl- |
| 4-Methyl-Cyclopenta(c)pyran-7-carboxaldehyde |
| 4-Methyl-Cyclopenta[c]pyran-7-carboxaldehyde |
| DTXSID50213042 |
| CHEBI:190770 |
| IHEBZQKYPSMVBZ-UHFFFAOYSA-N |
| 7-formyl-4-methylcyclopenta[c]pyran |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.17% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.03% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.98% | 98.95% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 91.06% | 90.24% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 90.81% | 98.11% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.10% | 96.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 85.06% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.80% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.43% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Viburnum opulus |
| PubChem | 594452 |
| LOTUS | LTS0043626 |
| wikiData | Q83088293 |