Verucopeptin
| Internal ID | e893717c-8b07-46b2-a133-f78968f0a390 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides > Cyclic glycodepsipeptides |
| IUPAC Name | 2-hydroxy-N-(17-hydroxy-8,14-dimethyl-2,6,9,12,15,18-hexaoxo-4-propan-2-yl-5-oxa-1,8,11,14,17,23-hexazabicyclo[17.4.0]tricosan-3-yl)-2-[2-hydroxy-5-methoxy-6-[(E)-4,6,8-trimethyldec-2-en-2-yl]oxan-2-yl]propanamide |
| SMILES (Canonical) | CCC(C)CC(C)CC(C)C=C(C)C1C(CCC(O1)(C(C)(C(=O)NC2C(OC(=O)CN(C(=O)CNC(=O)CN(C(=O)CN(C(=O)C3CCCNN3C2=O)O)C)C)C(C)C)O)O)OC |
| SMILES (Isomeric) | CCC(C)CC(C)CC(C)/C=C(\C)/C1C(CCC(O1)(C(C)(C(=O)NC2C(OC(=O)CN(C(=O)CNC(=O)CN(C(=O)CN(C(=O)C3CCCNN3C2=O)O)C)C)C(C)C)O)O)OC |
| InChI | InChI=1S/C43H73N7O13/c1-12-26(4)18-27(5)19-28(6)20-29(7)38-31(61-11)15-16-43(59,63-38)42(8,58)41(57)46-36-37(25(2)3)62-35(54)24-48(10)33(52)21-44-32(51)22-47(9)34(53)23-49(60)39(55)30-14-13-17-45-50(30)40(36)56/h20,25-28,30-31,36-38,45,58-60H,12-19,21-24H2,1-11H3,(H,44,51)(H,46,57)/b29-20+ |
| InChI Key | IKTLLLGZSOKVRF-ZTKZIYFRSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C43H73N7O13 |
| Molecular Weight | 896.10 g/mol |
| Exact Mass | 895.52663541 g/mol |
| Topological Polar Surface Area (TPSA) | 257.00 Ų |
| XlogP | 3.10 |
| Atomic LogP (AlogP) | 0.48 |
| H-Bond Acceptor | 14 |
| H-Bond Donor | 6 |
| Rotatable Bonds | 12 |
| 2-hydroxy-N-(17-hydroxy-8,14-dimethyl-2,6,9,12,15,18-hexaoxo-4-propan-2-yl-5-oxa-1,8,11,14,17,23-hexazabicyclo[17.4.0]tricosan-3-yl)-2-[2-hydroxy-5-methoxy-6-[(E)-4,6,8-trimethyldec-2-en-2-yl]oxan-2-yl]propanamide |
| 138067-14-8 |
| DTXSID701043987 |
| BU-3983T |
| BMY-28782 |
| 2-hydroxy-N-(17-hydroxy-8,14-dimethyl-2,6,9,12,15,18-hexaoxo-4-propan-2-yl-5-oxa-1,8,11,14,17,23-hexazabicyclo(17.4.0)tricosan-3-yl)-2-(2-hydroxy-5-methoxy-6-((E)-4,6,8-trimethyldec-2-en-2-yl)oxan-2-yl)propanamide |
| RefChem:934008 |
| DTXCID101526424 |
| 2XJ0D6E0XC |
| Glycine, 3-hydroxy-N-(2-hydroxy-1-oxo-2-(tetrahydro-2-hydroxy-5-methoxy-6-(1,3,5,7-tetramethyl-1-nonenyl)-2H-pyran-2-yl)propyl)leucylhexahydro-3-pyridazinecarbonyl-N-hydroxyglycyl-N-methylglycylglycyl-N-methyl-, rho-lactone |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5193 | 51.93% |
| Caco-2 | - | 0.8570 | 85.70% |
| Blood Brain Barrier | - | 0.8500 | 85.00% |
| Human oral bioavailability | - | 0.6714 | 67.14% |
| Subcellular localzation | Lysosomes | 0.3890 | 38.90% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8177 | 81.77% |
| OATP1B3 inhibitior | + | 0.9237 | 92.37% |
| MATE1 inhibitior | - | 0.9054 | 90.54% |
| OCT2 inhibitior | - | 0.9500 | 95.00% |
| BSEP inhibitior | + | 0.8894 | 88.94% |
| P-glycoprotein inhibitior | + | 0.7492 | 74.92% |
| P-glycoprotein substrate | + | 0.8384 | 83.84% |
| CYP3A4 substrate | + | 0.7467 | 74.67% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8678 | 86.78% |
| CYP3A4 inhibition | - | 0.8343 | 83.43% |
| CYP2C9 inhibition | - | 0.7537 | 75.37% |
| CYP2C19 inhibition | - | 0.7573 | 75.73% |
| CYP2D6 inhibition | - | 0.8773 | 87.73% |
| CYP1A2 inhibition | - | 0.7887 | 78.87% |
| CYP2C8 inhibition | + | 0.7712 | 77.12% |
| CYP inhibitory promiscuity | - | 0.9789 | 97.89% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8500 | 85.00% |
| Carcinogenicity (trinary) | Non-required | 0.4767 | 47.67% |
| Eye corrosion | - | 0.9793 | 97.93% |
| Eye irritation | - | 0.9034 | 90.34% |
| Skin irritation | - | 0.7465 | 74.65% |
| Skin corrosion | - | 0.9145 | 91.45% |
| Ames mutagenesis | - | 0.5100 | 51.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.5059 | 50.59% |
| Micronuclear | + | 0.7700 | 77.00% |
| Hepatotoxicity | - | 0.5000 | 50.00% |
| skin sensitisation | - | 0.8295 | 82.95% |
| Respiratory toxicity | + | 0.6778 | 67.78% |
| Reproductive toxicity | + | 0.9556 | 95.56% |
| Mitochondrial toxicity | + | 0.8500 | 85.00% |
| Nephrotoxicity | + | 0.5958 | 59.58% |
| Acute Oral Toxicity (c) | III | 0.6134 | 61.34% |
| Estrogen receptor binding | + | 0.8241 | 82.41% |
| Androgen receptor binding | + | 0.7400 | 74.00% |
| Thyroid receptor binding | + | 0.6107 | 61.07% |
| Glucocorticoid receptor binding | + | 0.7130 | 71.30% |
| Aromatase binding | + | 0.6317 | 63.17% |
| PPAR gamma | + | 0.8053 | 80.53% |
| Honey bee toxicity | - | 0.6580 | 65.80% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | + | 0.5200 | 52.00% |
| Fish aquatic toxicity | + | 0.8820 | 88.20% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.85% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.86% | 98.95% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 98.29% | 91.03% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.62% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.84% | 91.11% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 95.82% | 98.59% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 95.14% | 92.88% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.57% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.22% | 85.14% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.21% | 96.61% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.12% | 95.89% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 91.68% | 91.07% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.91% | 97.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.90% | 97.09% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 90.65% | 90.93% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 90.19% | 97.05% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 89.52% | 93.00% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 89.48% | 89.50% |
| CHEMBL3837 | P07711 | Cathepsin L | 88.61% | 96.61% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.92% | 89.00% |
| CHEMBL5957 | P21589 | 5'-nucleotidase | 86.16% | 97.78% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.12% | 94.73% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 85.07% | 92.12% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.50% | 92.62% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 83.67% | 97.28% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.02% | 100.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.94% | 93.03% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.80% | 96.47% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.46% | 95.50% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.41% | 96.95% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.34% | 90.08% |
| CHEMBL1859 | O95180 | Voltage-gated T-type calcium channel alpha-1H subunit | 81.13% | 98.57% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 81.00% | 96.25% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.88% | 91.19% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 80.38% | 96.39% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 80.29% | 95.36% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 80.25% | 89.34% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.16% | 96.77% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 80.07% | 97.79% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 80.03% | 95.34% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 6444237 |
| LOTUS | LTS0093599 |
| wikiData | Q77502101 |