Versicoloritide C
| Internal ID | c6e2ed51-73c4-4aff-ac7f-4023a9bac5ea |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | (3S,6S,12S,15S,18S)-3,12-dibenzyl-15-(hydroxymethyl)-1,4,10,13,16-pentazatricyclo[16.3.0.06,10]henicosane-2,5,11,14,17-pentone |
| SMILES (Canonical) | C1CC2C(=O)NC(C(=O)NC(C(=O)N3CCCC3C(=O)NC(C(=O)N2C1)CC4=CC=CC=C4)CC5=CC=CC=C5)CO |
| SMILES (Isomeric) | C1C[C@H]2C(=O)N[C@H](C(=O)N[C@H](C(=O)N3CCC[C@H]3C(=O)N[C@H](C(=O)N2C1)CC4=CC=CC=C4)CC5=CC=CC=C5)CO |
| InChI | InChI=1S/C31H37N5O6/c37-19-24-27(38)32-22(17-20-9-3-1-4-10-20)30(41)35-15-7-13-25(35)28(39)33-23(18-21-11-5-2-6-12-21)31(42)36-16-8-14-26(36)29(40)34-24/h1-6,9-12,22-26,37H,7-8,13-19H2,(H,32,38)(H,33,39)(H,34,40)/t22-,23-,24-,25-,26-/m0/s1 |
| InChI Key | DNTOQRXOEOKTNW-LROMGURASA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C31H37N5O6 |
| Molecular Weight | 575.70 g/mol |
| Exact Mass | 575.27438392 g/mol |
| Topological Polar Surface Area (TPSA) | 148.00 Ų |
| XlogP | 2.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.02% | 98.95% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 95.31% | 97.64% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.45% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.27% | 95.56% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 89.76% | 92.97% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.59% | 97.09% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 89.56% | 97.05% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.83% | 95.89% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.73% | 85.14% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.96% | 93.03% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.27% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.15% | 91.11% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.26% | 93.00% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 84.23% | 82.38% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.19% | 90.08% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.08% | 86.33% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 80.73% | 96.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 54672121 |
| LOTUS | LTS0217248 |
| wikiData | Q77504470 |