Verongamine
| Internal ID | 77858229-71f1-418f-abca-228c36495dbe |
| Taxonomy | Benzenoids > Phenol ethers > Anisoles |
| IUPAC Name | (2E)-3-(3-bromo-4-methoxyphenyl)-2-hydroxyimino-N-[2-(1H-imidazol-5-yl)ethyl]propanamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H17BrN4O3/c1-23-14-3-2-10(6-12(14)16)7-13(20-22)15(21)18-5-4-11-8-17-9-19-11/h2-3,6,8-9,22H,4-5,7H2,1H3,(H,17,19)(H,18,21)/b20-13+ |
| InChI Key | MFMMJKGZEGTTSV-DEDYPNTBSA-N |
| Popularity | 7 references in papers |
| Molecular Formula | C15H17BrN4O3 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.04840 g/mol |
| Topological Polar Surface Area (TPSA) | 99.60 Ų |
| XlogP | 2.60 |
| 150036-88-7 |
| CHEBI:66355 |
| DTXSID001318147 |
| (2E)-3-(3-bromo-4-methoxyphenyl)-2-hydroxyimino-N-[2-(1H-imidazol-5-yl)ethyl]propanamide |
| Benzenepropanamide, 3-bromo-alpha-(hydroxyimino)-N-(2-(1H-imidazol-4-yl)ethyl)-4-methoxy-, (E)- |
| (2E)-3-(3-bromo-4-methoxyphenyl)-2-hydroxyimino-N-(2-(1H-imidazol-5-yl)ethyl)propanamide |
| RefChem:194008 |
| DTXCID301747935 |
| L008857 |
| Q27134902 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.19% | 96.09% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 96.23% | 90.20% |
| CHEMBL2535 | P11166 | Glucose transporter | 96.12% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.41% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.15% | 98.95% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 93.77% | 95.92% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.43% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.18% | 94.45% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 92.00% | 90.24% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.05% | 90.00% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 87.06% | 92.88% |
| CHEMBL4296013 | Q5VWK5 | Interleukin-23 receptor | 86.06% | 88.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.06% | 96.00% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 85.57% | 85.31% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 85.24% | 92.29% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.19% | 86.33% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 84.61% | 81.11% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.07% | 96.90% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 82.50% | 98.59% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.29% | 85.14% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.20% | 91.24% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.13% | 90.71% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.24% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 9578063 |
| LOTUS | LTS0122981 |
| wikiData | Q27134902 |