Veraguamide L
| Internal ID | 5204c338-a19a-4ee2-b2d3-8f2087c274a9 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides |
| IUPAC Name | ethyl 2-[[1-[2-[2-[[2-[(8-bromo-3-hydroxy-2-methyloct-7-ynoyl)amino]-3-methylbutanoyl]-methylamino]-3-methylbutanoyl]oxy-3-methylbutanoyl]pyrrolidine-2-carbonyl]-methylamino]-3-methylbutanoate |
| SMILES (Canonical) | CCOC(=O)C(C(C)C)N(C)C(=O)C1CCCN1C(=O)C(C(C)C)OC(=O)C(C(C)C)N(C)C(=O)C(C(C)C)NC(=O)C(C)C(CCCC#CBr)O |
| SMILES (Isomeric) | CCOC(=O)C(C(C)C)N(C)C(=O)C1CCCN1C(=O)C(C(C)C)OC(=O)C(C(C)C)N(C)C(=O)C(C(C)C)NC(=O)C(C)C(CCCC#CBr)O |
| InChI | InChI=1S/C38H63BrN4O9/c1-13-51-37(49)30(23(4)5)41(11)34(46)27-18-17-21-43(27)36(48)32(25(8)9)52-38(50)31(24(6)7)42(12)35(47)29(22(2)3)40-33(45)26(10)28(44)19-15-14-16-20-39/h22-32,44H,13-15,17-19,21H2,1-12H3,(H,40,45) |
| InChI Key | XFJWITCKHVUBEG-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C38H63BrN4O9 |
| Molecular Weight | 799.80 g/mol |
| Exact Mass | 798.37784 g/mol |
| Topological Polar Surface Area (TPSA) | 163.00 Ų |
| XlogP | 6.50 |
| Atomic LogP (AlogP) | 3.74 |
| H-Bond Acceptor | 9 |
| H-Bond Donor | 2 |
| Rotatable Bonds | 19 |
| 8-Bromo-N-(1-((1-((1-(2-((1-ethoxy-3-methyl-1-oxobutan-2-yl)(methyl)carbamoyl)pyrrolidin-1-yl)-3-methyl-1-oxobutan-2-yl)oxy)-3-methyl-1-oxobutan-2-yl)(methyl)carbamoyl)-2-methylpropyl)-3-hydroxy-2-methyloct-7-ynimidate |
| 8-Bromo-N-[1-({1-[(1-{2-[(1-ethoxy-3-methyl-1-oxobutan-2-yl)(methyl)carbamoyl]pyrrolidin-1-yl}-3-methyl-1-oxobutan-2-yl)oxy]-3-methyl-1-oxobutan-2-yl}(methyl)carbamoyl)-2-methylpropyl]-3-hydroxy-2-methyloct-7-ynimidate |
| ethyl 2-((1-(2-(2-((2-((8-bromo-3-hydroxy-2-methyloct-7-ynoyl)amino)-3-methylbutanoyl)-methylamino)-3-methylbutanoyl)oxy-3-methylbutanoyl)pyrrolidine-2-carbonyl)-methylamino)-3-methylbutanoate |
| ethyl 2-[[1-[2-[2-[[2-[(8-bromo-3-hydroxy-2-methyloct-7-ynoyl)amino]-3-methylbutanoyl]-methylamino]-3-methylbutanoyl]oxy-3-methylbutanoyl]pyrrolidine-2-carbonyl]-methylamino]-3-methylbutanoate |
| RefChem:193952 |
| DTXSID701304595 |
| 1-{2-[(1-Ethoxy-3-methyl-1-oxobutan-2-yl)(methyl)carbamoyl]pyrrolidin-1-yl}-3-methyl-1-oxobutan-2-yl 2-[{2-[(8-bromo-3-hydroxy-2-methyloct-7-ynoyl)amino]-3-methylbutanoyl}(methyl)amino]-3-methylbutanoate |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.4917 | 49.17% |
| Caco-2 | - | 0.8490 | 84.90% |
| Blood Brain Barrier | - | 0.7250 | 72.50% |
| Human oral bioavailability | + | 0.5429 | 54.29% |
| Subcellular localzation | Mitochondria | 0.5421 | 54.21% |
| OATP2B1 inhibitior | - | 0.7132 | 71.32% |
| OATP1B1 inhibitior | + | 0.8790 | 87.90% |
| OATP1B3 inhibitior | + | 0.9249 | 92.49% |
| MATE1 inhibitior | - | 0.8600 | 86.00% |
| OCT2 inhibitior | - | 0.9250 | 92.50% |
| BSEP inhibitior | + | 0.6374 | 63.74% |
| P-glycoprotein inhibitior | + | 0.7347 | 73.47% |
| P-glycoprotein substrate | + | 0.7465 | 74.65% |
| CYP3A4 substrate | + | 0.7131 | 71.31% |
| CYP2C9 substrate | - | 0.7982 | 79.82% |
| CYP2D6 substrate | - | 0.8407 | 84.07% |
| CYP3A4 inhibition | - | 0.6313 | 63.13% |
| CYP2C9 inhibition | - | 0.8481 | 84.81% |
| CYP2C19 inhibition | - | 0.8021 | 80.21% |
| CYP2D6 inhibition | - | 0.8900 | 89.00% |
| CYP1A2 inhibition | - | 0.8382 | 83.82% |
| CYP2C8 inhibition | - | 0.5786 | 57.86% |
| CYP inhibitory promiscuity | - | 0.8043 | 80.43% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.7961 | 79.61% |
| Carcinogenicity (trinary) | Non-required | 0.5823 | 58.23% |
| Eye corrosion | - | 0.9831 | 98.31% |
| Eye irritation | - | 0.9104 | 91.04% |
| Skin irritation | - | 0.7868 | 78.68% |
| Skin corrosion | - | 0.9200 | 92.00% |
| Ames mutagenesis | - | 0.5800 | 58.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.3980 | 39.80% |
| Micronuclear | + | 0.7000 | 70.00% |
| Hepatotoxicity | + | 0.6941 | 69.41% |
| skin sensitisation | - | 0.8700 | 87.00% |
| Respiratory toxicity | + | 0.6889 | 68.89% |
| Reproductive toxicity | + | 0.7889 | 78.89% |
| Mitochondrial toxicity | + | 0.7750 | 77.50% |
| Nephrotoxicity | + | 0.5911 | 59.11% |
| Acute Oral Toxicity (c) | III | 0.6233 | 62.33% |
| Estrogen receptor binding | + | 0.8195 | 81.95% |
| Androgen receptor binding | + | 0.6466 | 64.66% |
| Thyroid receptor binding | + | 0.5380 | 53.80% |
| Glucocorticoid receptor binding | + | 0.7040 | 70.40% |
| Aromatase binding | + | 0.6454 | 64.54% |
| PPAR gamma | + | 0.7084 | 70.84% |
| Honey bee toxicity | - | 0.7351 | 73.51% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | - | 0.5400 | 54.00% |
| Fish aquatic toxicity | - | 0.5207 | 52.07% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.10% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.94% | 96.09% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 96.78% | 98.33% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 96.72% | 96.47% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 96.71% | 97.47% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 96.35% | 94.66% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 96.12% | 98.75% |
| CHEMBL3837 | P07711 | Cathepsin L | 95.92% | 96.61% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.62% | 93.56% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 94.53% | 95.52% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 94.15% | 92.12% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 93.26% | 96.38% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 92.83% | 90.08% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 92.57% | 98.77% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.39% | 91.19% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 92.13% | 100.00% |
| CHEMBL4072 | P07858 | Cathepsin B | 92.08% | 93.67% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 91.96% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.35% | 97.09% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.17% | 95.89% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 90.95% | 99.18% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 90.54% | 94.33% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 90.39% | 97.50% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 90.00% | 96.31% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 89.64% | 93.03% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 88.91% | 98.24% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.39% | 90.71% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.17% | 96.21% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 87.93% | 94.50% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 87.03% | 97.56% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 86.97% | 93.10% |
| CHEMBL3238 | P23786 | Carnitine palmitoyltransferase 2 | 86.58% | 94.05% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 86.37% | 98.10% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 86.34% | 96.25% |
| CHEMBL283 | P08254 | Matrix metalloproteinase 3 | 86.28% | 97.29% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.81% | 97.14% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.64% | 95.50% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 85.61% | 99.17% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.60% | 92.50% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.42% | 97.25% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.14% | 96.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 85.00% | 96.90% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 84.94% | 95.17% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 84.91% | 95.36% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 84.48% | 98.05% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.31% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.29% | 90.17% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.99% | 100.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.84% | 96.77% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 83.52% | 100.00% |
| CHEMBL1871 | P10275 | Androgen Receptor | 83.35% | 96.43% |
| CHEMBL5028 | O14672 | ADAM10 | 83.16% | 97.50% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 83.15% | 95.71% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.78% | 90.24% |
| CHEMBL4822 | P56817 | Beta-secretase 1 | 82.31% | 97.35% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.77% | 95.89% |
| CHEMBL228 | P31645 | Serotonin transporter | 81.58% | 95.51% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 81.31% | 95.34% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 80.47% | 92.86% |
| CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 80.41% | 91.65% |
| CHEMBL3691 | Q13822 | Autotaxin | 80.01% | 96.39% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 53262812 |
| LOTUS | LTS0169057 |
| wikiData | Q104200928 |