8,9-Dimethoxy-1,2,3,4,5-benzopentathiepin-6-ethanamine
| Internal ID | b4bda752-6e68-4bf3-9c56-9d657b866636 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Phenethylamines |
| IUPAC Name | 2-(6,7-dimethoxy-1,2,3,4,5-benzopentathiepin-9-yl)ethanamine |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H13NO2S5/c1-12-7-5-6(3-4-11)9-10(8(7)13-2)15-17-18-16-14-9/h5H,3-4,11H2,1-2H3 |
| InChI Key | HIKCOAGMCNIBMP-UHFFFAOYSA-N |
| Popularity | 28 references in papers |
| Molecular Formula | C10H13NO2S5 |
| Molecular Weight | 339.60 g/mol |
| Exact Mass | 338.95498453 g/mol |
| Topological Polar Surface Area (TPSA) | 171.00 Ų |
| XlogP | 2.70 |
| Varacine |
| 134029-48-4 |
| 6-Benzopentathiepinethanamine, 8,9-dimethoxy- |
| 2-(6,7-dimethoxy-1,2,3,4,5-benzopentathiepin-9-yl)ethanamine |
| 85V98E6A3M |
| DTXSID10158465 |
| 1,2,3,4,5-Benzopentathiepin-6-ethanamine, 8,9-dimethoxy- |
| 8,9-DIMETHOXY-1,2,3,4,5-BENZOPENTATHIEPIN-6-ETHANAMINE |
| RefChem:1074603 |
| DTXCID5080956 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.52% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.93% | 91.11% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 93.12% | 90.24% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.81% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.61% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.18% | 96.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.72% | 96.95% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 88.12% | 90.20% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.78% | 95.50% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.63% | 94.00% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 84.51% | 95.48% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.86% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.80% | 95.56% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.28% | 92.62% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.10% | 89.62% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 80.19% | 95.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 179269 |
| LOTUS | LTS0214204 |
| wikiData | Q3034003 |