Vanillylamine
| Internal ID | 56c82082-2663-49bf-8062-394fc0bf7005 |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | 4-(aminomethyl)-2-methoxyphenol |
| SMILES (Canonical) | COC1=C(C=CC(=C1)CN)O |
| SMILES (Isomeric) | COC1=C(C=CC(=C1)CN)O |
| InChI | InChI=1S/C8H11NO2/c1-11-8-4-6(5-9)2-3-7(8)10/h2-4,10H,5,9H2,1H3 |
| InChI Key | WRPWWVNUCXQDQV-UHFFFAOYSA-N |
| Popularity | 199 references in papers |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.078978594 g/mol |
| Topological Polar Surface Area (TPSA) | 55.50 Ų |
| XlogP | -0.20 |
| 4-(Aminomethyl)-2-methoxyphenol |
| 1196-92-5 |
| 4-Hydroxy-3-methoxybenzylamine |
| Phenol, 4-(aminomethyl)-2-methoxy- |
| vanillylamin |
| 3-Methoxy-4-hydroxybenzylamine |
| 4-Aminomethyl-2-methoxy-phenol |
| p-Cresol, .alpha.-amino-2-methoxy- |
| (4-Hydroxy-3-methoxyphenyl)methanamine |
| 1WEZ91E3Z0 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.69% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.19% | 91.11% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 96.75% | 90.24% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.59% | 99.17% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 89.31% | 90.20% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.29% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.19% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.14% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.59% | 95.56% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.37% | 96.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.82% | 95.89% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.28% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.84% | 98.75% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.93% | 89.62% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.47% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Capsicum annuum |
| Capsicum annuum var. glabriusculum |
| PubChem | 70966 |
| LOTUS | LTS0214938 |
| wikiData | Q17105361 |