Valylglutamic acid
| Internal ID | 83ae02be-f098-49cd-9db7-f98ad5118bad |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Dipeptides |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]pentanedioic acid |
| SMILES (Canonical) | CC(C)C(C(=O)NC(CCC(=O)O)C(=O)O)N |
| SMILES (Isomeric) | CC(C)[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)O)N |
| InChI | InChI=1S/C10H18N2O5/c1-5(2)8(11)9(15)12-6(10(16)17)3-4-7(13)14/h5-6,8H,3-4,11H2,1-2H3,(H,12,15)(H,13,14)(H,16,17)/t6-,8-/m0/s1 |
| InChI Key | UPJONISHZRADBH-XPUUQOCRSA-N |
| Popularity | 17 references in papers |
| Molecular Formula | C10H18N2O5 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12157168 g/mol |
| Topological Polar Surface Area (TPSA) | 130.00 Ų |
| XlogP | -3.90 |
| Val-Glu |
| 3062-07-5 |
| valylglutamic acid |
| (S)-2-((S)-2-Amino-3-methylbutanamido)pentanedioic acid |
| L-VALYL-L-GLUTAMIC ACID |
| L-Val-L-Glu |
| L-Valyl-L-Glutamate |
| 424-59-9 |
| Valylglutamate |
| Valyl-Glutamate |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.61% | 83.82% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.95% | 90.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.64% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.02% | 96.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.26% | 93.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.10% | 99.17% |
| CHEMBL3776 | Q14790 | Caspase-8 | 92.09% | 97.06% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 89.28% | 100.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 89.22% | 90.20% |
| CHEMBL236 | P41143 | Delta opioid receptor | 87.10% | 99.35% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.38% | 96.47% |
| CHEMBL3308 | P55212 | Caspase-6 | 84.63% | 97.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.45% | 90.71% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 82.94% | 100.00% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 82.39% | 92.29% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.94% | 89.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.79% | 94.45% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 81.02% | 98.33% |
| CHEMBL4801 | P29466 | Caspase-1 | 80.74% | 96.85% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.38% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Glycine max |
| PubChem | 7009623 |
| LOTUS | LTS0178879 |
| wikiData | Q27145070 |