Uridine-5'-diphosphate-glucose
Internal ID | 3df39001-f7b9-42ef-bd6c-98f5bd4f2112 |
Taxonomy | Nucleosides, nucleotides, and analogues > Pyrimidine nucleotides > Pyrimidine nucleotide sugars |
IUPAC Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen phosphate |
SMILES (Canonical) | C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OC3C(C(C(C(O3)CO)O)O)O)O)O |
SMILES (Isomeric) | C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)(O)OP(=O)(O)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O |
InChI | InChI=1S/C15H24N2O17P2/c18-3-5-8(20)10(22)12(24)14(32-5)33-36(28,29)34-35(26,27)30-4-6-9(21)11(23)13(31-6)17-2-1-7(19)16-15(17)25/h1-2,5-6,8-14,18,20-24H,3-4H2,(H,26,27)(H,28,29)(H,16,19,25)/t5-,6-,8-,9-,10+,11-,12-,13-,14-/m1/s1 |
InChI Key | HSCJRCZFDFQWRP-JZMIEXBBSA-N |
Popularity | 1,356 references in papers |
Molecular Formula | C15H24N2O17P2 |
Molecular Weight | 566.30 g/mol |
Exact Mass | 566.05502130 g/mol |
Topological Polar Surface Area (TPSA) | 292.00 Ų |
XlogP | -6.30 |
Atomic LogP (AlogP) | -4.79 |
H-Bond Acceptor | 16 |
H-Bond Donor | 9 |
Rotatable Bonds | 9 |
URIDINE DIPHOSPHATE GLUCOSE |
UDPG |
133-89-1 |
UDP-alpha-D-Glucose |
co-waldenase |
URIDINE-5'-DIPHOSPHATE-GLUCOSE |
UDPglucose |
co-galactoisomerase |
UDP-a-D-Glucose |
UDP-D-glucose |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | - | 0.9424 | 94.24% |
Caco-2 | - | 0.8971 | 89.71% |
Blood Brain Barrier | - | 0.6000 | 60.00% |
Human oral bioavailability | - | 0.7571 | 75.71% |
Subcellular localzation | Mitochondria | 0.4598 | 45.98% |
OATP2B1 inhibitior | - | 0.8588 | 85.88% |
OATP1B1 inhibitior | + | 0.9194 | 91.94% |
OATP1B3 inhibitior | + | 0.9415 | 94.15% |
MATE1 inhibitior | - | 0.9200 | 92.00% |
OCT2 inhibitior | - | 0.9500 | 95.00% |
BSEP inhibitior | - | 0.6028 | 60.28% |
P-glycoprotein inhibitior | - | 0.5443 | 54.43% |
P-glycoprotein substrate | - | 0.8461 | 84.61% |
CYP3A4 substrate | + | 0.5982 | 59.82% |
CYP2C9 substrate | - | 0.5958 | 59.58% |
CYP2D6 substrate | - | 0.8648 | 86.48% |
CYP3A4 inhibition | + | 0.5000 | 50.00% |
CYP2C9 inhibition | - | 0.8605 | 86.05% |
CYP2C19 inhibition | - | 0.8096 | 80.96% |
CYP2D6 inhibition | - | 0.8544 | 85.44% |
CYP1A2 inhibition | - | 0.8601 | 86.01% |
CYP2C8 inhibition | - | 0.7700 | 77.00% |
CYP inhibitory promiscuity | - | 0.7607 | 76.07% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.8500 | 85.00% |
Carcinogenicity (trinary) | Non-required | 0.5043 | 50.43% |
Eye corrosion | - | 0.9840 | 98.40% |
Eye irritation | - | 0.9436 | 94.36% |
Skin irritation | - | 0.7799 | 77.99% |
Skin corrosion | - | 0.9323 | 93.23% |
Ames mutagenesis | - | 0.7600 | 76.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.6645 | 66.45% |
Micronuclear | + | 0.9700 | 97.00% |
Hepatotoxicity | - | 0.5165 | 51.65% |
skin sensitisation | - | 0.8497 | 84.97% |
Respiratory toxicity | + | 0.7333 | 73.33% |
Reproductive toxicity | + | 0.9444 | 94.44% |
Mitochondrial toxicity | + | 0.9000 | 90.00% |
Nephrotoxicity | - | 0.6077 | 60.77% |
Acute Oral Toxicity (c) | III | 0.5164 | 51.64% |
Estrogen receptor binding | + | 0.6816 | 68.16% |
Androgen receptor binding | + | 0.7976 | 79.76% |
Thyroid receptor binding | - | 0.4896 | 48.96% |
Glucocorticoid receptor binding | - | 0.4644 | 46.44% |
Aromatase binding | + | 0.5739 | 57.39% |
PPAR gamma | + | 0.6601 | 66.01% |
Honey bee toxicity | - | 0.6692 | 66.92% |
Biodegradation | - | 0.6750 | 67.50% |
Crustacea aquatic toxicity | - | 0.6500 | 65.00% |
Fish aquatic toxicity | - | 0.4206 | 42.06% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4518 | Q15391 | Purinergic receptor P2Y14 |
350 nM 588 nM 670 nM 910 nM 400 nM 261 nM 354 nM |
EC50 EC50 EC50 EC50 EC50 EC50 EC50 |
PMID: 17407275
via Super-PRED via Super-PRED via Super-PRED PMID: 19902968 PMID: 19502066 PMID: 17088057 |
CHEMBL4398 | P41231 | Purinergic receptor P2Y2 |
10000 nM |
EC50 |
PMID: 19502066
|
CHEMBL4714 | Q15077 | Pyrimidinergic receptor P2Y6 |
1600 nM |
EC50 |
PMID: 19902968
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.29% | 96.09% |
CHEMBL2123 | P51582 | Pyrimidinergic receptor P2Y4 | 95.93% | 93.39% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 93.29% | 86.92% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.86% | 95.93% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 89.56% | 80.33% |
CHEMBL2581 | P07339 | Cathepsin D | 88.27% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.47% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.25% | 94.73% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 84.01% | 92.38% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.17% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.00% | 94.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.68% | 95.83% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.80% | 97.09% |
CHEMBL3230 | O95977 | Sphingosine 1-phosphate receptor Edg-6 | 80.44% | 94.01% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arabidopsis thaliana |
Glycine max |
Helianthus tuberosus |
PubChem | 8629 |
NPASS | NPC155087 |
ChEMBL | CHEMBL375951 |
LOTUS | LTS0071938 |
wikiData | Q424649 |