Unk-Trp-D-Glu-Asn(3-OH)-Thr(1)-Sar-Ala-Asp-D-Lys-Asp-Gly-D-Asn-DL-Glu-xiIle-(1)
| Internal ID | 54aab7e1-86af-486f-a4f2-ffd78811add2 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (4R)-5-[[(2S)-4-amino-1-[[(3S,9R,15S,18R,21S,24S,30S,31R)-18-(4-aminobutyl)-9-(2-amino-2-oxoethyl)-3-butan-2-yl-6-(2-carboxyethyl)-15,21-bis(carboxymethyl)-24,28,31-trimethyl-2,5,8,11,14,17,20,23,26,29-decaoxo-1-oxa-4,7,10,13,16,19,22,25,28-nonazacyclohentriacont-30-yl]amino]-3-hydroxy-1,4-dioxobutan-2-yl]amino]-4-[[(2S)-3-(1H-indol-3-yl)-2-(8-methyldecanoylamino)propanoyl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | CCC(C)CCCCCCC(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)NC(CCC(=O)O)C(=O)NC(C(C(=O)N)O)C(=O)NC3C(OC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CN(C3=O)C)C)CC(=O)O)CCCCN)CC(=O)O)CC(=O)N)CCC(=O)O)C(C)CC)C |
| SMILES (Isomeric) | CCC(C)CCCCCCC(=O)N[C@@H](CC1=CNC2=CC=CC=C21)C(=O)N[C@H](CCC(=O)O)C(=O)N[C@@H](C(C(=O)N)O)C(=O)N[C@H]3[C@H](OC(=O)[C@@H](NC(=O)C(NC(=O)[C@H](NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CN(C3=O)C)C)CC(=O)O)CCCCN)CC(=O)O)CC(=O)N)CCC(=O)O)C(C)CC)C |
| InChI | InChI=1S/C72H109N17O26/c1-8-35(3)18-12-10-11-13-22-50(91)79-45(28-39-32-76-41-20-15-14-19-40(39)41)67(109)82-44(24-26-54(96)97)66(108)88-59(60(102)61(75)103)70(112)87-58-38(6)115-72(114)57(36(4)9-2)86-65(107)43(23-25-53(94)95)83-68(110)46(29-49(74)90)80-51(92)33-77-63(105)47(30-55(98)99)85-64(106)42(21-16-17-27-73)81-69(111)48(31-56(100)101)84-62(104)37(5)78-52(93)34-89(7)71(58)113/h14-15,19-20,32,35-38,42-48,57-60,76,102H,8-13,16-18,21-31,33-34,73H2,1-7H3,(H2,74,90)(H2,75,103)(H,77,105)(H,78,93)(H,79,91)(H,80,92)(H,81,111)(H,82,109)(H,83,110)(H,84,104)(H,85,106)(H,86,107)(H,87,112)(H,88,108)(H,94,95)(H,96,97)(H,98,99)(H,100,101)/t35?,36?,37-,38+,42+,43?,44+,45-,46+,47-,48-,57-,58-,59-,60?/m0/s1 |
| InChI Key | BBLKNYOAWQBWSP-QFDKOERDSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C72H109N17O26 |
| Molecular Weight | 1628.70 g/mol |
| Exact Mass | 1627.77296665 g/mol |
| Topological Polar Surface Area (TPSA) | 693.00 Ų |
| XlogP | -4.90 |
| Atomic LogP (AlogP) | -5.45 |
| H-Bond Acceptor | 23 |
| H-Bond Donor | 21 |
| Rotatable Bonds | 37 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.5985 | 59.85% |
| Caco-2 | - | 0.8630 | 86.30% |
| Blood Brain Barrier | - | 0.9000 | 90.00% |
| Human oral bioavailability | - | 0.6714 | 67.14% |
| Subcellular localzation | Lysosomes | 0.4443 | 44.43% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8155 | 81.55% |
| OATP1B3 inhibitior | + | 0.9167 | 91.67% |
| MATE1 inhibitior | - | 0.7609 | 76.09% |
| OCT2 inhibitior | - | 0.9750 | 97.50% |
| BSEP inhibitior | + | 0.9590 | 95.90% |
| P-glycoprotein inhibitior | + | 0.7418 | 74.18% |
| P-glycoprotein substrate | + | 0.8839 | 88.39% |
| CYP3A4 substrate | + | 0.7546 | 75.46% |
| CYP2C9 substrate | - | 0.7925 | 79.25% |
| CYP2D6 substrate | - | 0.7933 | 79.33% |
| CYP3A4 inhibition | - | 0.8325 | 83.25% |
| CYP2C9 inhibition | - | 0.8617 | 86.17% |
| CYP2C19 inhibition | - | 0.8868 | 88.68% |
| CYP2D6 inhibition | - | 0.9175 | 91.75% |
| CYP1A2 inhibition | - | 0.9252 | 92.52% |
| CYP2C8 inhibition | + | 0.8291 | 82.91% |
| CYP inhibitory promiscuity | - | 0.9600 | 96.00% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.8900 | 89.00% |
| Carcinogenicity (trinary) | Non-required | 0.5915 | 59.15% |
| Eye corrosion | - | 0.9885 | 98.85% |
| Eye irritation | - | 0.8954 | 89.54% |
| Skin irritation | - | 0.7757 | 77.57% |
| Skin corrosion | - | 0.9289 | 92.89% |
| Ames mutagenesis | - | 0.8237 | 82.37% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7091 | 70.91% |
| Micronuclear | + | 0.8200 | 82.00% |
| Hepatotoxicity | - | 0.6073 | 60.73% |
| skin sensitisation | - | 0.8837 | 88.37% |
| Respiratory toxicity | + | 0.8111 | 81.11% |
| Reproductive toxicity | + | 0.9778 | 97.78% |
| Mitochondrial toxicity | + | 0.9375 | 93.75% |
| Nephrotoxicity | + | 0.5890 | 58.90% |
| Acute Oral Toxicity (c) | III | 0.5512 | 55.12% |
| Estrogen receptor binding | - | 0.5117 | 51.17% |
| Androgen receptor binding | + | 0.7149 | 71.49% |
| Thyroid receptor binding | + | 0.7802 | 78.02% |
| Glucocorticoid receptor binding | + | 0.8334 | 83.34% |
| Aromatase binding | + | 0.8101 | 81.01% |
| PPAR gamma | + | 0.7732 | 77.32% |
| Honey bee toxicity | - | 0.6348 | 63.48% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.5500 | 55.00% |
| Fish aquatic toxicity | + | 0.6934 | 69.34% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.87% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.78% | 96.61% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.57% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.96% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.77% | 85.14% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.15% | 99.17% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 96.43% | 97.64% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.42% | 95.56% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 96.33% | 93.10% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 96.10% | 96.11% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 95.59% | 88.42% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 95.16% | 98.05% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.07% | 93.99% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 93.13% | 98.33% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 93.01% | 91.81% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 92.22% | 96.90% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 92.18% | 90.08% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 91.80% | 93.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.07% | 99.23% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 91.00% | 83.82% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.00% | 96.47% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 90.93% | 95.00% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 90.66% | 92.32% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.48% | 97.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.19% | 97.09% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 90.08% | 90.20% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 89.69% | 88.56% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 89.64% | 94.66% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 89.52% | 95.56% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 89.51% | 98.59% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 89.48% | 97.23% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 89.15% | 85.83% |
| CHEMBL4071 | P08311 | Cathepsin G | 88.87% | 94.64% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 88.80% | 89.50% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 88.73% | 82.38% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.55% | 94.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.02% | 89.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.88% | 94.45% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 86.06% | 93.18% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 85.81% | 96.31% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.39% | 89.62% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 84.96% | 97.00% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 84.10% | 95.92% |
| CHEMBL1949 | P62937 | Cyclophilin A | 84.01% | 98.57% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.81% | 95.89% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 83.54% | 96.28% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.44% | 100.00% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 82.93% | 100.00% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 82.69% | 82.86% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 82.57% | 94.45% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 82.02% | 96.25% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.00% | 86.33% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.87% | 100.00% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 81.78% | 100.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.64% | 98.75% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.60% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139588591 |
| LOTUS | LTS0014274 |
| wikiData | Q104922825 |