2-[(3S,6S,9Z,12S,15S,18R,21S,24R,27S)-21,24-bis(2-aminoethyl)-15-(3-aminopropyl)-3-[(1S)-2-chloro-1-hydroxyethyl]-9-ethylidene-27-(3-hydroxydodecanoylamino)-12-[(1S)-1-hydroxyethyl]-18-(2-hydroxyethyl)-2,5,8,11,14,17,20,23,26-nonaoxo-1-oxa-4,7,10,13,16,19,22,25-octazacyclooctacos-6-yl]-2-hydroxyacetic acid
| Internal ID | 70a16e26-6874-4475-9528-c3e652594178 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | 2-[(3S,6S,9Z,12S,15S,18R,21S,24R,27S)-21,24-bis(2-aminoethyl)-15-(3-aminopropyl)-3-[(1S)-2-chloro-1-hydroxyethyl]-9-ethylidene-27-(3-hydroxydodecanoylamino)-12-[(1S)-1-hydroxyethyl]-18-(2-hydroxyethyl)-2,5,8,11,14,17,20,23,26-nonaoxo-1-oxa-4,7,10,13,16,19,22,25-octazacyclooctacos-6-yl]-2-hydroxyacetic acid |
| SMILES (Canonical) | CCCCCCCCCC(CC(=O)NC1COC(=O)C(NC(=O)C(NC(=O)C(=CC)NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)CCN)CCN)CCO)CCCN)C(C)O)C(C(=O)O)O)C(CCl)O)O |
| SMILES (Isomeric) | CCCCCCCCCC(CC(=O)N[C@H]1COC(=O)[C@@H](NC(=O)[C@@H](NC(=O)/C(=C/C)/NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](NC(=O)[C@@H](NC(=O)[C@H](NC1=O)CCN)CCN)CCO)CCCN)[C@H](C)O)C(C(=O)O)O)[C@@H](CCl)O)O |
| InChI | InChI=1S/C48H83ClN12O18/c1-4-6-7-8-9-10-11-13-26(64)22-34(66)53-32-24-79-48(78)36(33(65)23-49)60-46(75)37(38(67)47(76)77)61-39(68)27(5-2)54-45(74)35(25(3)63)59-43(72)28(14-12-18-50)55-42(71)31(17-21-62)58-41(70)29(15-19-51)56-40(69)30(16-20-52)57-44(32)73/h5,25-26,28-33,35-38,62-65,67H,4,6-24,50-52H2,1-3H3,(H,53,66)(H,54,74)(H,55,71)(H,56,69)(H,57,73)(H,58,70)(H,59,72)(H,60,75)(H,61,68)(H,76,77)/b27-5-/t25-,26?,28-,29-,30+,31+,32-,33+,35-,36-,37-,38?/m0/s1 |
| InChI Key | REUXMKNGXWSXFN-XFQUZUBOSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C48H83ClN12O18 |
| Molecular Weight | 1151.70 g/mol |
| Exact Mass | 1150.5636815 g/mol |
| Topological Polar Surface Area (TPSA) | 505.00 Ų |
| XlogP | -4.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.70% | 94.45% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.59% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.30% | 91.11% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 98.62% | 89.63% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.58% | 96.09% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 97.41% | 97.29% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 96.82% | 96.47% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.52% | 98.95% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 96.21% | 92.88% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 95.31% | 98.03% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.27% | 99.17% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 94.76% | 95.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 94.50% | 95.50% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 94.48% | 96.11% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 93.88% | 89.34% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 93.88% | 92.86% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.37% | 97.09% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 93.23% | 95.71% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 92.23% | 94.80% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 91.67% | 95.20% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 90.88% | 96.90% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 90.04% | 92.32% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 89.92% | 98.75% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.13% | 100.00% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 88.87% | 94.66% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.60% | 95.56% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 87.70% | 90.08% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.63% | 90.71% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 87.43% | 93.18% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.90% | 90.17% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 86.37% | 95.93% |
| CHEMBL3837 | P07711 | Cathepsin L | 86.37% | 96.61% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.19% | 96.61% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 85.79% | 97.79% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.94% | 100.00% |
| CHEMBL236 | P41143 | Delta opioid receptor | 84.48% | 99.35% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.46% | 89.50% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 84.41% | 87.45% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 83.97% | 91.38% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.68% | 93.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.64% | 93.56% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 83.32% | 100.00% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 83.01% | 92.29% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 82.46% | 80.71% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 82.25% | 94.55% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 81.46% | 96.33% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.45% | 94.75% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.00% | 91.24% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.95% | 97.25% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.88% | 98.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.57% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101623468 |
| LOTUS | LTS0024372 |
| wikiData | Q105235113 |